About ethyl (5R,7S)-2-(3,5-difluorophenyl)-1-oxo-2-azaspiro[4.5]decane-7-carboxylate
ethyl (5R,7S)-2-(3,5-difluorophenyl)-1-oxo-2-azaspiro[4.5]decane-7-carboxylate (PubChem CID 67108456) has the molecular formula C18H21F2NO3
and a molecular weight of 337.37 g/mol. Its IUPAC name is ethyl (5R,7S)-2-(3,5-difluorophenyl)-1-oxo-2-azaspiro[4.5]decane-7-carboxylate.
Molecular Properties
| Compound Name | ethyl (5R,7S)-2-(3,5-difluorophenyl)-1-oxo-2-azaspiro[4.5]decane-7-carboxylate |
| PubChem CID | 67108456 |
| Molecular Formula | C18H21F2NO3 |
| Molecular Weight | 337.37 g/mol |
| Exact Mass | 337.15 |
| IUPAC Name | ethyl (5R,7S)-2-(3,5-difluorophenyl)-1-oxo-2-azaspiro[4.5]decane-7-carboxylate |
| SMILES | CCOC(=O)[C@H]1CCC[C@]2(CCN(c3cc(F)cc(F)c3)C2=O)C1 |
| InChI | InChI=1S/C18H21F2NO3/c1-2-24-16(22)12-4-3-5-18(11-12)6-7-21(17(18)23)15-9-13(19)8-14(20)10-15/h8-10,12H,2-7,11H2,1H3/t12-,18-/m0/s1 |
| InChIKey | MBEIZLABMXEYSA-SGTLLEGYSA-N |
| XLogP | 3.44 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 337.37 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze ethyl (5R,7S)-2-(3,5-difluorophenyl)-1-oxo-2-azaspiro[4.5]decane-7-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl (5R,7S)-2-(3,5-difluorophenyl)-1-oxo-2-azaspiro[4.5]decane-7-carboxylate?
The IUPAC name of ethyl (5R,7S)-2-(3,5-difluorophenyl)-1-oxo-2-azaspiro[4.5]decane-7-carboxylate (CID 67108456) is ethyl (5R,7S)-2-(3,5-difluorophenyl)-1-oxo-2-azaspiro[4.5]decane-7-carboxylate.
What is the SMILES notation for ethyl (5R,7S)-2-(3,5-difluorophenyl)-1-oxo-2-azaspiro[4.5]decane-7-carboxylate?
The canonical SMILES for ethyl (5R,7S)-2-(3,5-difluorophenyl)-1-oxo-2-azaspiro[4.5]decane-7-carboxylate is CCOC(=O)[C@H]1CCC[C@]2(CCN(c3cc(F)cc(F)c3)C2=O)C1.
What is the InChIKey of ethyl (5R,7S)-2-(3,5-difluorophenyl)-1-oxo-2-azaspiro[4.5]decane-7-carboxylate?
The InChIKey is MBEIZLABMXEYSA-SGTLLEGYSA-N. The full InChI is InChI=1S/C18H21F2NO3/c1-2-24-16(22)12-4-3-5-18(11-12)6-7-21(17(18)23)15-9-13(19)8-14(20)10-15/h8-10,12H,2-7,11H2,1H3/t12-,18-/m0/s1.
What are the key properties of ethyl (5R,7S)-2-(3,5-difluorophenyl)-1-oxo-2-azaspiro[4.5]decane-7-carboxylate?
ethyl (5R,7S)-2-(3,5-difluorophenyl)-1-oxo-2-azaspiro[4.5]decane-7-carboxylate has a molecular weight of 337.37 g/mol, XLogP of 3.44, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl (5R,7S)-2-(3,5-difluorophenyl)-1-oxo-2-azaspiro[4.5]decane-7-carboxylate is sourced from PubChem (CID 67108456), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).