C20H20ClN3O3S2 — CID 67108753
4-[3-[(6-chloro-1-benzothiophen-2-yl)sulfonyl]-3-pyridin-4-ylpropyl]piperazin-2-one (PubChem CID 67108753) has the molecular formula C20H20ClN3O3S2 and a molecular weight of 449.99 g/mol. Its IUPAC name is 4-[3-[(6-chloro-1-benzothiophen-2-yl)sulfonyl]-3-pyridin-4-ylpropyl]piperazin-2-one.
| Compound Name | 4-[3-[(6-chloro-1-benzothiophen-2-yl)sulfonyl]-3-pyridin-4-ylpropyl]piperazin-2-one |
|---|---|
| PubChem CID | 67108753 |
| Molecular Formula | C20H20ClN3O3S2 |
| Molecular Weight | 449.99 g/mol |
| Exact Mass | 449.06 |
| IUPAC Name | 4-[3-[(6-chloro-1-benzothiophen-2-yl)sulfonyl]-3-pyridin-4-ylpropyl]piperazin-2-one |
| SMILES | O=C1CN(CCC(c2ccncc2)S(=O)(=O)c2cc3ccc(Cl)cc3s2)CCN1 |
| InChI | InChI=1S/C20H20ClN3O3S2/c21-16-2-1-15-11-20(28-17(15)12-16)29(26,27)18(14-3-6-22-7-4-14)5-9-24-10-8-23-19(25)13-24/h1-4,6-7,11-12,18H,5,8-10,13H2,(H,23,25) |
| InChIKey | IQCGVNAZNNHPNH-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 79.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.99 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |