C20H16N2O3 — CID 67108937
2-(3,5-dimethyl-1,2-oxazol-4-yl)-3-(4-hydroxyphenyl)indole-1-carbaldehyde (PubChem CID 67108937) has the molecular formula C20H16N2O3 and a molecular weight of 332.36 g/mol. Its IUPAC name is 2-(3,5-dimethyl-1,2-oxazol-4-yl)-3-(4-hydroxyphenyl)indole-1-carbaldehyde.
| Compound Name | 2-(3,5-dimethyl-1,2-oxazol-4-yl)-3-(4-hydroxyphenyl)indole-1-carbaldehyde |
|---|---|
| PubChem CID | 67108937 |
| Molecular Formula | C20H16N2O3 |
| Molecular Weight | 332.36 g/mol |
| Exact Mass | 332.12 |
| IUPAC Name | 2-(3,5-dimethyl-1,2-oxazol-4-yl)-3-(4-hydroxyphenyl)indole-1-carbaldehyde |
| SMILES | Cc1noc(C)c1-c1c(-c2ccc(O)cc2)c2ccccc2n1C=O |
| InChI | InChI=1S/C20H16N2O3/c1-12-18(13(2)25-21-12)20-19(14-7-9-15(24)10-8-14)16-5-3-4-6-17(16)22(20)11-23/h3-11,24H,1-2H3 |
| InChIKey | QTJHEWKMGVFPSE-UHFFFAOYSA-N |
| XLogP | 4.32 |
| TPSA | 68.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.36 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|