About 3-imidazo[2,1-b][1,3,4]thiadiazol-2-ylpropan-1-amine
3-imidazo[2,1-b][1,3,4]thiadiazol-2-ylpropan-1-amine (PubChem CID 67109051) has the molecular formula C7H10N4S
and a molecular weight of 182.25 g/mol. Its IUPAC name is 3-imidazo[2,1-b][1,3,4]thiadiazol-2-ylpropan-1-amine.
Molecular Properties
| Compound Name | 3-imidazo[2,1-b][1,3,4]thiadiazol-2-ylpropan-1-amine |
| PubChem CID | 67109051 |
| Molecular Formula | C7H10N4S |
| Molecular Weight | 182.25 g/mol |
| Exact Mass | 182.06 |
| IUPAC Name | 3-imidazo[2,1-b][1,3,4]thiadiazol-2-ylpropan-1-amine |
| SMILES | NCCCc1nn2ccnc2s1 |
| InChI | InChI=1S/C7H10N4S/c8-3-1-2-6-10-11-5-4-9-7(11)12-6/h4-5H,1-3,8H2 |
| InChIKey | ZKCQMXBTZPRDSE-UHFFFAOYSA-N |
| XLogP | 0.68 |
| TPSA | 56.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 182.25 |
| LogP ≤ 5 | 0.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 3-imidazo[2,1-b][1,3,4]thiadiazol-2-ylpropan-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-imidazo[2,1-b][1,3,4]thiadiazol-2-ylpropan-1-amine?
The IUPAC name of 3-imidazo[2,1-b][1,3,4]thiadiazol-2-ylpropan-1-amine (CID 67109051) is 3-imidazo[2,1-b][1,3,4]thiadiazol-2-ylpropan-1-amine.
What is the SMILES notation for 3-imidazo[2,1-b][1,3,4]thiadiazol-2-ylpropan-1-amine?
The canonical SMILES for 3-imidazo[2,1-b][1,3,4]thiadiazol-2-ylpropan-1-amine is NCCCc1nn2ccnc2s1.
What is the InChIKey of 3-imidazo[2,1-b][1,3,4]thiadiazol-2-ylpropan-1-amine?
The InChIKey is ZKCQMXBTZPRDSE-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H10N4S/c8-3-1-2-6-10-11-5-4-9-7(11)12-6/h4-5H,1-3,8H2.
What are the key properties of 3-imidazo[2,1-b][1,3,4]thiadiazol-2-ylpropan-1-amine?
3-imidazo[2,1-b][1,3,4]thiadiazol-2-ylpropan-1-amine has a molecular weight of 182.25 g/mol, XLogP of 0.68, 3 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-imidazo[2,1-b][1,3,4]thiadiazol-2-ylpropan-1-amine is sourced from PubChem (CID 67109051), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).