C16H25N2O2+ — CID 67110317
6-(2,3,3-trimethyl-1,2-dihydropyrrolo[2,3-b]pyridin-7-ium-7-yl)hexanoic acid (PubChem CID 67110317) has the molecular formula C16H25N2O2+ and a molecular weight of 277.39 g/mol. Its IUPAC name is 6-(2,3,3-trimethyl-1,2-dihydropyrrolo[2,3-b]pyridin-7-ium-7-yl)hexanoic acid.
| Compound Name | 6-(2,3,3-trimethyl-1,2-dihydropyrrolo[2,3-b]pyridin-7-ium-7-yl)hexanoic acid |
|---|---|
| PubChem CID | 67110317 |
| Molecular Formula | C16H25N2O2+ |
| Molecular Weight | 277.39 g/mol |
| Exact Mass | 277.19 |
| IUPAC Name | 6-(2,3,3-trimethyl-1,2-dihydropyrrolo[2,3-b]pyridin-7-ium-7-yl)hexanoic acid |
| SMILES | CC1Nc2c(ccc[n+]2CCCCCC(=O)O)C1(C)C |
| InChI | InChI=1S/C16H24N2O2/c1-12-16(2,3)13-8-7-11-18(15(13)17-12)10-6-4-5-9-14(19)20/h7-8,11-12H,4-6,9-10H2,1-3H3,(H,19,20)/p+1 |
| InChIKey | TUYXRSHGGXZTNX-UHFFFAOYSA-O |
| XLogP | 2.71 |
| TPSA | 53.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.39 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|