About butyl 6-[[2-(dimethylamino)-1,3-benzoxazol-5-yl]oxy]-4-hydroxy-1-oxo-2H-isoquinoline-3-carboxylate
butyl 6-[[2-(dimethylamino)-1,3-benzoxazol-5-yl]oxy]-4-hydroxy-1-oxo-2H-isoquinoline-3-carboxylate (PubChem CID 67110327) has the molecular formula C23H23N3O6
and a molecular weight of 437.45 g/mol. Its IUPAC name is butyl 6-[[2-(dimethylamino)-1,3-benzoxazol-5-yl]oxy]-4-hydroxy-1-oxo-2H-isoquinoline-3-carboxylate.
Molecular Properties
| Compound Name | butyl 6-[[2-(dimethylamino)-1,3-benzoxazol-5-yl]oxy]-4-hydroxy-1-oxo-2H-isoquinoline-3-carboxylate |
| PubChem CID | 67110327 |
| Molecular Formula | C23H23N3O6 |
| Molecular Weight | 437.45 g/mol |
| Exact Mass | 437.16 |
| IUPAC Name | butyl 6-[[2-(dimethylamino)-1,3-benzoxazol-5-yl]oxy]-4-hydroxy-1-oxo-2H-isoquinoline-3-carboxylate |
| SMILES | CCCCOC(=O)c1[nH]c(=O)c2ccc(Oc3ccc4oc(N(C)C)nc4c3)cc2c1O |
| InChI | InChI=1S/C23H23N3O6/c1-4-5-10-30-22(29)19-20(27)16-11-13(6-8-15(16)21(28)25-19)31-14-7-9-18-17(12-14)24-23(32-18)26(2)3/h6-9,11-12,27H,4-5,10H2,1-3H3,(H,25,28) |
| InChIKey | JYDBYHICTNCRQN-UHFFFAOYSA-N |
| XLogP | 4.19 |
| TPSA | 117.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 437.45 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze butyl 6-[[2-(dimethylamino)-1,3-benzoxazol-5-yl]oxy]-4-hydroxy-1-oxo-2H-isoquinoline-3-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of butyl 6-[[2-(dimethylamino)-1,3-benzoxazol-5-yl]oxy]-4-hydroxy-1-oxo-2H-isoquinoline-3-carboxylate?
The IUPAC name of butyl 6-[[2-(dimethylamino)-1,3-benzoxazol-5-yl]oxy]-4-hydroxy-1-oxo-2H-isoquinoline-3-carboxylate (CID 67110327) is butyl 6-[[2-(dimethylamino)-1,3-benzoxazol-5-yl]oxy]-4-hydroxy-1-oxo-2H-isoquinoline-3-carboxylate.
What is the SMILES notation for butyl 6-[[2-(dimethylamino)-1,3-benzoxazol-5-yl]oxy]-4-hydroxy-1-oxo-2H-isoquinoline-3-carboxylate?
The canonical SMILES for butyl 6-[[2-(dimethylamino)-1,3-benzoxazol-5-yl]oxy]-4-hydroxy-1-oxo-2H-isoquinoline-3-carboxylate is CCCCOC(=O)c1[nH]c(=O)c2ccc(Oc3ccc4oc(N(C)C)nc4c3)cc2c1O.
What is the InChIKey of butyl 6-[[2-(dimethylamino)-1,3-benzoxazol-5-yl]oxy]-4-hydroxy-1-oxo-2H-isoquinoline-3-carboxylate?
The InChIKey is JYDBYHICTNCRQN-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H23N3O6/c1-4-5-10-30-22(29)19-20(27)16-11-13(6-8-15(16)21(28)25-19)31-14-7-9-18-17(12-14)24-23(32-18)26(2)3/h6-9,11-12,27H,4-5,10H2,1-3H3,(H,25,28).
What are the key properties of butyl 6-[[2-(dimethylamino)-1,3-benzoxazol-5-yl]oxy]-4-hydroxy-1-oxo-2H-isoquinoline-3-carboxylate?
butyl 6-[[2-(dimethylamino)-1,3-benzoxazol-5-yl]oxy]-4-hydroxy-1-oxo-2H-isoquinoline-3-carboxylate has a molecular weight of 437.45 g/mol, XLogP of 4.19, 7 rotatable bonds, 2 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for butyl 6-[[2-(dimethylamino)-1,3-benzoxazol-5-yl]oxy]-4-hydroxy-1-oxo-2H-isoquinoline-3-carboxylate is sourced from PubChem (CID 67110327), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).