C22H20F2N6O2S — CID 67110610
[2,6-difluoro-4-[2-(pyridin-3-ylamino)pyrrolo[2,3-d]pyrimidin-7-yl]phenyl]-thiomorpholin-4-ylmethanediol (PubChem CID 67110610) has the molecular formula C22H20F2N6O2S and a molecular weight of 470.51 g/mol. Its IUPAC name is [2,6-difluoro-4-[2-(pyridin-3-ylamino)pyrrolo[2,3-d]pyrimidin-7-yl]phenyl]-thiomorpholin-4-ylmethanediol.
| Compound Name | [2,6-difluoro-4-[2-(pyridin-3-ylamino)pyrrolo[2,3-d]pyrimidin-7-yl]phenyl]-thiomorpholin-4-ylmethanediol |
|---|---|
| PubChem CID | 67110610 |
| Molecular Formula | C22H20F2N6O2S |
| Molecular Weight | 470.51 g/mol |
| Exact Mass | 470.13 |
| IUPAC Name | [2,6-difluoro-4-[2-(pyridin-3-ylamino)pyrrolo[2,3-d]pyrimidin-7-yl]phenyl]-thiomorpholin-4-ylmethanediol |
| SMILES | OC(O)(c1c(F)cc(-n2ccc3cnc(Nc4cccnc4)nc32)cc1F)N1CCSCC1 |
| InChI | InChI=1S/C22H20F2N6O2S/c23-17-10-16(11-18(24)19(17)22(31,32)29-6-8-33-9-7-29)30-5-3-14-12-26-21(28-20(14)30)27-15-2-1-4-25-13-15/h1-5,10-13,31-32H,6-9H2,(H,26,27,28) |
| InChIKey | KAOJYVLHIAZUGA-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 99.33 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.51 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|