C20H18N2O2 — CID 67110656
(1S,14R,15R)-13-(furan-2-yl)-6,7-diazapentacyclo[13.2.1.01,12.03,11.04,8]octadeca-3(11),4(8),5,9,12-pentaen-14-ol (PubChem CID 67110656) has the molecular formula C20H18N2O2 and a molecular weight of 318.38 g/mol. Its IUPAC name is (1S,14R,15R)-13-(furan-2-yl)-6,7-diazapentacyclo[13.2.1.01,12.03,11.04,8]octadeca-3(11),4(8),5,9,12-pentaen-14-ol.
| Compound Name | (1S,14R,15R)-13-(furan-2-yl)-6,7-diazapentacyclo[13.2.1.01,12.03,11.04,8]octadeca-3(11),4(8),5,9,12-pentaen-14-ol |
|---|---|
| PubChem CID | 67110656 |
| Molecular Formula | C20H18N2O2 |
| Molecular Weight | 318.38 g/mol |
| Exact Mass | 318.14 |
| IUPAC Name | (1S,14R,15R)-13-(furan-2-yl)-6,7-diazapentacyclo[13.2.1.01,12.03,11.04,8]octadeca-3(11),4(8),5,9,12-pentaen-14-ol |
| SMILES | O[C@H]1C(c2ccco2)=C2c3ccc4[nH]ncc4c3C[C@@]23CC[C@@H]1C3 |
| InChI | InChI=1S/C20H18N2O2/c23-19-11-5-6-20(8-11)9-13-12(3-4-15-14(13)10-21-22-15)18(20)17(19)16-2-1-7-24-16/h1-4,7,10-11,19,23H,5-6,8-9H2,(H,21,22)/t11-,19-,20+/m1/s1 |
| InChIKey | JYXRAKKBVPDTFM-LAOHPYGUSA-N |
| XLogP | 3.78 |
| TPSA | 62.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.38 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |