C17H17ClN2O — CID 67110676
(1S,14R,15R)-13-chloro-14-methoxy-6,7-diazapentacyclo[13.2.1.01,12.03,11.04,8]octadeca-3(11),4(8),5,9,12-pentaene (PubChem CID 67110676) has the molecular formula C17H17ClN2O and a molecular weight of 300.79 g/mol. Its IUPAC name is (1S,14R,15R)-13-chloro-14-methoxy-6,7-diazapentacyclo[13.2.1.01,12.03,11.04,8]octadeca-3(11),4(8),5,9,12-pentaene.
| Compound Name | (1S,14R,15R)-13-chloro-14-methoxy-6,7-diazapentacyclo[13.2.1.01,12.03,11.04,8]octadeca-3(11),4(8),5,9,12-pentaene |
|---|---|
| PubChem CID | 67110676 |
| Molecular Formula | C17H17ClN2O |
| Molecular Weight | 300.79 g/mol |
| Exact Mass | 300.10 |
| IUPAC Name | (1S,14R,15R)-13-chloro-14-methoxy-6,7-diazapentacyclo[13.2.1.01,12.03,11.04,8]octadeca-3(11),4(8),5,9,12-pentaene |
| SMILES | CO[C@H]1C(Cl)=C2c3ccc4[nH]ncc4c3C[C@@]23CC[C@@H]1C3 |
| InChI | InChI=1S/C17H17ClN2O/c1-21-16-9-4-5-17(6-9)7-11-10(14(17)15(16)18)2-3-13-12(11)8-19-20-13/h2-3,8-9,16H,4-7H2,1H3,(H,19,20)/t9-,16-,17+/m1/s1 |
| InChIKey | NTRJJCJRYGLNBT-TVNTUTRRSA-N |
| XLogP | 3.88 |
| TPSA | 37.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.79 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |