C31H31F3N4O4 — CID 67110740
2-[3-(3,3-diphenylpropylamino)propyl]-4,5-dihydropyrazolo[3,4-f]isoquinoline-3-carboxylic acid;2,2,2-trifluoroacetic acid (PubChem CID 67110740) has the molecular formula C31H31F3N4O4 and a molecular weight of 580.61 g/mol. Its IUPAC name is 2-[3-(3,3-diphenylpropylamino)propyl]-4,5-dihydropyrazolo[3,4-f]isoquinoline-3-carboxylic acid;2,2,2-trifluoroacetic acid.
| Compound Name | 2-[3-(3,3-diphenylpropylamino)propyl]-4,5-dihydropyrazolo[3,4-f]isoquinoline-3-carboxylic acid;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 67110740 |
| Molecular Formula | C31H31F3N4O4 |
| Molecular Weight | 580.61 g/mol |
| Exact Mass | 580.23 |
| IUPAC Name | 2-[3-(3,3-diphenylpropylamino)propyl]-4,5-dihydropyrazolo[3,4-f]isoquinoline-3-carboxylic acid;2,2,2-trifluoroacetic acid |
| SMILES | O=C(O)C(F)(F)F.O=C(O)c1c2c(nn1CCCNCCC(c1ccccc1)c1ccccc1)-c1ccncc1CC2 |
| InChI | InChI=1S/C29H30N4O2.C2HF3O2/c34-29(35)28-26-13-12-23-20-31-18-15-25(23)27(26)32-33(28)19-7-16-30-17-14-24(21-8-3-1-4-9-21)22-10-5-2-6-11-22;3-2(4,5)1(6)7/h1-6,8-11,15,18,20,24,30H,7,12-14,16-17,19H2,(H,34,35);(H,6,7) |
| InChIKey | DEMVKYFZNXOARX-UHFFFAOYSA-N |
| XLogP | 5.58 |
| TPSA | 117.34 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 580.61 |
| LogP ≤ 5 | 5.58 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|