About 2-(1,3-dioxan-2-yl)-4,4-dimethyl-1,3-dioxane
2-(1,3-dioxan-2-yl)-4,4-dimethyl-1,3-dioxane (PubChem CID 67111042) has the molecular formula C10H18O4
and a molecular weight of 202.25 g/mol. Its IUPAC name is 2-(1,3-dioxan-2-yl)-4,4-dimethyl-1,3-dioxane.
Molecular Properties
| Compound Name | 2-(1,3-dioxan-2-yl)-4,4-dimethyl-1,3-dioxane |
| PubChem CID | 67111042 |
| Molecular Formula | C10H18O4 |
| Molecular Weight | 202.25 g/mol |
| Exact Mass | 202.12 |
| IUPAC Name | 2-(1,3-dioxan-2-yl)-4,4-dimethyl-1,3-dioxane |
| SMILES | CC1(C)CCOC(C2OCCCO2)O1 |
| InChI | InChI=1S/C10H18O4/c1-10(2)4-7-13-9(14-10)8-11-5-3-6-12-8/h8-9H,3-7H2,1-2H3 |
| InChIKey | ISLKHPNYUZKYNW-UHFFFAOYSA-N |
| XLogP | 1.29 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 202.25 |
| LogP ≤ 5 | 1.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-(1,3-dioxan-2-yl)-4,4-dimethyl-1,3-dioxane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(1,3-dioxan-2-yl)-4,4-dimethyl-1,3-dioxane?
The IUPAC name of 2-(1,3-dioxan-2-yl)-4,4-dimethyl-1,3-dioxane (CID 67111042) is 2-(1,3-dioxan-2-yl)-4,4-dimethyl-1,3-dioxane.
What is the SMILES notation for 2-(1,3-dioxan-2-yl)-4,4-dimethyl-1,3-dioxane?
The canonical SMILES for 2-(1,3-dioxan-2-yl)-4,4-dimethyl-1,3-dioxane is CC1(C)CCOC(C2OCCCO2)O1.
What is the InChIKey of 2-(1,3-dioxan-2-yl)-4,4-dimethyl-1,3-dioxane?
The InChIKey is ISLKHPNYUZKYNW-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H18O4/c1-10(2)4-7-13-9(14-10)8-11-5-3-6-12-8/h8-9H,3-7H2,1-2H3.
What are the key properties of 2-(1,3-dioxan-2-yl)-4,4-dimethyl-1,3-dioxane?
2-(1,3-dioxan-2-yl)-4,4-dimethyl-1,3-dioxane has a molecular weight of 202.25 g/mol, XLogP of 1.29, 1 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(1,3-dioxan-2-yl)-4,4-dimethyl-1,3-dioxane is sourced from PubChem (CID 67111042), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).