C18H29N5O6 — CID 6711121
methyl 6-[2-[3-(1H-imidazol-5-yl)-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoyl]hydrazinyl]-6-oxohexanoate (PubChem CID 6711121) has the molecular formula C18H29N5O6 and a molecular weight of 411.46 g/mol. Its IUPAC name is methyl 6-[2-[3-(1H-imidazol-5-yl)-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoyl]hydrazinyl]-6-oxohexanoate.
| Compound Name | methyl 6-[2-[3-(1H-imidazol-5-yl)-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoyl]hydrazinyl]-6-oxohexanoate |
|---|---|
| PubChem CID | 6711121 |
| Molecular Formula | C18H29N5O6 |
| Molecular Weight | 411.46 g/mol |
| Exact Mass | 411.21 |
| IUPAC Name | methyl 6-[2-[3-(1H-imidazol-5-yl)-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoyl]hydrazinyl]-6-oxohexanoate |
| SMILES | COC(=O)CCCCC(=O)NNC(=O)C(Cc1cnc[nH]1)NC(=O)OC(C)(C)C |
| InChI | InChI=1S/C18H29N5O6/c1-18(2,3)29-17(27)21-13(9-12-10-19-11-20-12)16(26)23-22-14(24)7-5-6-8-15(25)28-4/h10-11,13H,5-9H2,1-4H3,(H,19,20)(H,21,27)(H,22,24)(H,23,26) |
| InChIKey | LGOHAOMUNJWUEH-UHFFFAOYSA-N |
| XLogP | 0.73 |
| TPSA | 151.51 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.46 |
| LogP ≤ 5 | 0.73 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|