About 3-methylcyclopenten-1-ol
3-methylcyclopenten-1-ol (PubChem CID 67111347) has the molecular formula C6H10O
and a molecular weight of 98.14 g/mol. Its IUPAC name is 3-methylcyclopenten-1-ol.
Molecular Properties
| Compound Name | 3-methylcyclopenten-1-ol |
| PubChem CID | 67111347 |
| Molecular Formula | C6H10O |
| Molecular Weight | 98.14 g/mol |
| Exact Mass | 98.07 |
| IUPAC Name | 3-methylcyclopenten-1-ol |
| SMILES | CC1C=C(O)CC1 |
| InChI | InChI=1S/C6H10O/c1-5-2-3-6(7)4-5/h4-5,7H,2-3H2,1H3 |
| InChIKey | FRDPVMYBYHTZNL-UHFFFAOYSA-N |
| XLogP | 1.86 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 7 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 98.14 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 3-methylcyclopenten-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-methylcyclopenten-1-ol?
The IUPAC name of 3-methylcyclopenten-1-ol (CID 67111347) is 3-methylcyclopenten-1-ol.
What is the SMILES notation for 3-methylcyclopenten-1-ol?
The canonical SMILES for 3-methylcyclopenten-1-ol is CC1C=C(O)CC1.
What is the InChIKey of 3-methylcyclopenten-1-ol?
The InChIKey is FRDPVMYBYHTZNL-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H10O/c1-5-2-3-6(7)4-5/h4-5,7H,2-3H2,1H3.
What are the key properties of 3-methylcyclopenten-1-ol?
3-methylcyclopenten-1-ol has a molecular weight of 98.14 g/mol, XLogP of 1.86, 0 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 3-methylcyclopenten-1-ol is sourced from PubChem (CID 67111347), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).