C14H22O11 — CID 67111872
3-methoxy-2-prop-2-enyl-2-[(3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxybutanedioic acid (PubChem CID 67111872) has the molecular formula C14H22O11 and a molecular weight of 366.32 g/mol. Its IUPAC name is 3-methoxy-2-prop-2-enyl-2-[(3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxybutanedioic acid.
| Compound Name | 3-methoxy-2-prop-2-enyl-2-[(3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxybutanedioic acid |
|---|---|
| PubChem CID | 67111872 |
| Molecular Formula | C14H22O11 |
| Molecular Weight | 366.32 g/mol |
| Exact Mass | 366.12 |
| IUPAC Name | 3-methoxy-2-prop-2-enyl-2-[(3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxybutanedioic acid |
| SMILES | C=CCC(OC1O[C@H](CO)[C@@H](O)[C@H](O)[C@H]1O)(C(=O)O)C(OC)C(=O)O |
| InChI | InChI=1S/C14H22O11/c1-3-4-14(13(21)22,10(23-2)11(19)20)25-12-9(18)8(17)7(16)6(5-15)24-12/h3,6-10,12,15-18H,1,4-5H2,2H3,(H,19,20)(H,21,22)/t6-,7-,8+,9-,10?,12?,14?/m1/s1 |
| InChIKey | RVIQFCDKEAVGOD-SWMUUJJFSA-N |
| XLogP | -2.70 |
| TPSA | 183.21 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.32 |
| LogP ≤ 5 | -2.70 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|