About 2-[2-piperidin-4-yl-4-(2,2,2-trifluoroethyl)imidazol-1-yl]ethanol;dihydrochloride
2-[2-piperidin-4-yl-4-(2,2,2-trifluoroethyl)imidazol-1-yl]ethanol;dihydrochloride (PubChem CID 67112089) has the molecular formula C12H20Cl2F3N3O
and a molecular weight of 350.21 g/mol. Its IUPAC name is 2-[2-piperidin-4-yl-4-(2,2,2-trifluoroethyl)imidazol-1-yl]ethanol;dihydrochloride.
Molecular Properties
| Compound Name | 2-[2-piperidin-4-yl-4-(2,2,2-trifluoroethyl)imidazol-1-yl]ethanol;dihydrochloride |
| PubChem CID | 67112089 |
| Molecular Formula | C12H20Cl2F3N3O |
| Molecular Weight | 350.21 g/mol |
| Exact Mass | 349.09 |
| IUPAC Name | 2-[2-piperidin-4-yl-4-(2,2,2-trifluoroethyl)imidazol-1-yl]ethanol;dihydrochloride |
| SMILES | Cl.Cl.OCCn1cc(CC(F)(F)F)nc1C1CCNCC1 |
| InChI | InChI=1S/C12H18F3N3O.2ClH/c13-12(14,15)7-10-8-18(5-6-19)11(17-10)9-1-3-16-4-2-9;;/h8-9,16,19H,1-7H2;2*1H |
| InChIKey | WEQMCZCWPKVXRC-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 50.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 350.21 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-[2-piperidin-4-yl-4-(2,2,2-trifluoroethyl)imidazol-1-yl]ethanol;dihydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[2-piperidin-4-yl-4-(2,2,2-trifluoroethyl)imidazol-1-yl]ethanol;dihydrochloride?
The IUPAC name of 2-[2-piperidin-4-yl-4-(2,2,2-trifluoroethyl)imidazol-1-yl]ethanol;dihydrochloride (CID 67112089) is 2-[2-piperidin-4-yl-4-(2,2,2-trifluoroethyl)imidazol-1-yl]ethanol;dihydrochloride.
What is the SMILES notation for 2-[2-piperidin-4-yl-4-(2,2,2-trifluoroethyl)imidazol-1-yl]ethanol;dihydrochloride?
The canonical SMILES for 2-[2-piperidin-4-yl-4-(2,2,2-trifluoroethyl)imidazol-1-yl]ethanol;dihydrochloride is Cl.Cl.OCCn1cc(CC(F)(F)F)nc1C1CCNCC1.
What is the InChIKey of 2-[2-piperidin-4-yl-4-(2,2,2-trifluoroethyl)imidazol-1-yl]ethanol;dihydrochloride?
The InChIKey is WEQMCZCWPKVXRC-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H18F3N3O.2ClH/c13-12(14,15)7-10-8-18(5-6-19)11(17-10)9-1-3-16-4-2-9;;/h8-9,16,19H,1-7H2;2*1H.
What are the key properties of 2-[2-piperidin-4-yl-4-(2,2,2-trifluoroethyl)imidazol-1-yl]ethanol;dihydrochloride?
2-[2-piperidin-4-yl-4-(2,2,2-trifluoroethyl)imidazol-1-yl]ethanol;dihydrochloride has a molecular weight of 350.21 g/mol, XLogP of 2.29, 4 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[2-piperidin-4-yl-4-(2,2,2-trifluoroethyl)imidazol-1-yl]ethanol;dihydrochloride is sourced from PubChem (CID 67112089), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).