C16H30N2O2Si — CID 67112213
1-[(1S,2R,3S,5R)-2-[tert-butyl(dimethyl)silyl]oxy-3-bicyclo[3.1.0]hexanyl]piperazin-2-one (PubChem CID 67112213) has the molecular formula C16H30N2O2Si and a molecular weight of 310.51 g/mol. Its IUPAC name is 1-[(1S,2R,3S,5R)-2-[tert-butyl(dimethyl)silyl]oxy-3-bicyclo[3.1.0]hexanyl]piperazin-2-one.
| Compound Name | 1-[(1S,2R,3S,5R)-2-[tert-butyl(dimethyl)silyl]oxy-3-bicyclo[3.1.0]hexanyl]piperazin-2-one |
|---|---|
| PubChem CID | 67112213 |
| Molecular Formula | C16H30N2O2Si |
| Molecular Weight | 310.51 g/mol |
| Exact Mass | 310.21 |
| IUPAC Name | 1-[(1S,2R,3S,5R)-2-[tert-butyl(dimethyl)silyl]oxy-3-bicyclo[3.1.0]hexanyl]piperazin-2-one |
| SMILES | CC(C)(C)[Si](C)(C)O[C@@H]1[C@H]2C[C@@H]2C[C@@H]1N1CCNCC1=O |
| InChI | InChI=1S/C16H30N2O2Si/c1-16(2,3)21(4,5)20-15-12-8-11(12)9-13(15)18-7-6-17-10-14(18)19/h11-13,15,17H,6-10H2,1-5H3/t11-,12+,13+,15-/m1/s1 |
| InChIKey | PMUSTGOWORYSOI-UKTARXLSSA-N |
| XLogP | 2.22 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.51 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|