C28H25N5O3S — CID 67112993
N-[1-[4-[[4-(3-hydroxypropylamino)benzoyl]amino]phenyl]indazol-5-yl]thiophene-2-carboxamide (PubChem CID 67112993) has the molecular formula C28H25N5O3S and a molecular weight of 511.61 g/mol. Its IUPAC name is N-[1-[4-[[4-(3-hydroxypropylamino)benzoyl]amino]phenyl]indazol-5-yl]thiophene-2-carboxamide.
| Compound Name | N-[1-[4-[[4-(3-hydroxypropylamino)benzoyl]amino]phenyl]indazol-5-yl]thiophene-2-carboxamide |
|---|---|
| PubChem CID | 67112993 |
| Molecular Formula | C28H25N5O3S |
| Molecular Weight | 511.61 g/mol |
| Exact Mass | 511.17 |
| IUPAC Name | N-[1-[4-[[4-(3-hydroxypropylamino)benzoyl]amino]phenyl]indazol-5-yl]thiophene-2-carboxamide |
| SMILES | O=C(Nc1ccc(-n2ncc3cc(NC(=O)c4cccs4)ccc32)cc1)c1ccc(NCCCO)cc1 |
| InChI | InChI=1S/C28H25N5O3S/c34-15-2-14-29-21-6-4-19(5-7-21)27(35)31-22-8-11-24(12-9-22)33-25-13-10-23(17-20(25)18-30-33)32-28(36)26-3-1-16-37-26/h1,3-13,16-18,29,34H,2,14-15H2,(H,31,35)(H,32,36) |
| InChIKey | HIVRVZBLIAVNFH-UHFFFAOYSA-N |
| XLogP | 5.39 |
| TPSA | 108.28 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 511.61 |
| LogP ≤ 5 | 5.39 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|