About 2-[benzyl-[(1S,2S)-2-hydroxy-2-(1-phenylethenyl)cyclobutyl]amino]acetonitrile
2-[benzyl-[(1S,2S)-2-hydroxy-2-(1-phenylethenyl)cyclobutyl]amino]acetonitrile (PubChem CID 6711318) has the molecular formula C21H22N2O
and a molecular weight of 318.42 g/mol. Its IUPAC name is 2-[benzyl-[(1S,2S)-2-hydroxy-2-(1-phenylethenyl)cyclobutyl]amino]acetonitrile.
Molecular Properties
| Compound Name | 2-[benzyl-[(1S,2S)-2-hydroxy-2-(1-phenylethenyl)cyclobutyl]amino]acetonitrile |
| PubChem CID | 6711318 |
| Molecular Formula | C21H22N2O |
| Molecular Weight | 318.42 g/mol |
| Exact Mass | 318.17 |
| IUPAC Name | 2-[benzyl-[(1S,2S)-2-hydroxy-2-(1-phenylethenyl)cyclobutyl]amino]acetonitrile |
| SMILES | C=C(c1ccccc1)[C@@]1(O)CC[C@@H]1N(CC#N)Cc1ccccc1 |
| InChI | InChI=1S/C21H22N2O/c1-17(19-10-6-3-7-11-19)21(24)13-12-20(21)23(15-14-22)16-18-8-4-2-5-9-18/h2-11,20,24H,1,12-13,15-16H2/t20-,21-/m0/s1 |
| InChIKey | LLFYZUZEQWBNPP-SFTDATJTSA-N |
| XLogP | 3.62 |
| TPSA | 47.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 318.42 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'cyanamide', 'substructure': 'N/A'} |
|---|
Analyze 2-[benzyl-[(1S,2S)-2-hydroxy-2-(1-phenylethenyl)cyclobutyl]amino]acetonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[benzyl-[(1S,2S)-2-hydroxy-2-(1-phenylethenyl)cyclobutyl]amino]acetonitrile?
The IUPAC name of 2-[benzyl-[(1S,2S)-2-hydroxy-2-(1-phenylethenyl)cyclobutyl]amino]acetonitrile (CID 6711318) is 2-[benzyl-[(1S,2S)-2-hydroxy-2-(1-phenylethenyl)cyclobutyl]amino]acetonitrile.
What is the SMILES notation for 2-[benzyl-[(1S,2S)-2-hydroxy-2-(1-phenylethenyl)cyclobutyl]amino]acetonitrile?
The canonical SMILES for 2-[benzyl-[(1S,2S)-2-hydroxy-2-(1-phenylethenyl)cyclobutyl]amino]acetonitrile is C=C(c1ccccc1)[C@@]1(O)CC[C@@H]1N(CC#N)Cc1ccccc1.
What is the InChIKey of 2-[benzyl-[(1S,2S)-2-hydroxy-2-(1-phenylethenyl)cyclobutyl]amino]acetonitrile?
The InChIKey is LLFYZUZEQWBNPP-SFTDATJTSA-N. The full InChI is InChI=1S/C21H22N2O/c1-17(19-10-6-3-7-11-19)21(24)13-12-20(21)23(15-14-22)16-18-8-4-2-5-9-18/h2-11,20,24H,1,12-13,15-16H2/t20-,21-/m0/s1.
What are the key properties of 2-[benzyl-[(1S,2S)-2-hydroxy-2-(1-phenylethenyl)cyclobutyl]amino]acetonitrile?
2-[benzyl-[(1S,2S)-2-hydroxy-2-(1-phenylethenyl)cyclobutyl]amino]acetonitrile has a molecular weight of 318.42 g/mol, XLogP of 3.62, 6 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[benzyl-[(1S,2S)-2-hydroxy-2-(1-phenylethenyl)cyclobutyl]amino]acetonitrile is sourced from PubChem (CID 6711318), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).