About 2-O-benzyl 1-O-butyl cyclohexane-1,2-dicarboxylate
2-O-benzyl 1-O-butyl cyclohexane-1,2-dicarboxylate (PubChem CID 67113211) has the molecular formula C19H26O4
and a molecular weight of 318.41 g/mol. Its IUPAC name is 2-O-benzyl 1-O-butyl cyclohexane-1,2-dicarboxylate.
Molecular Properties
| Compound Name | 2-O-benzyl 1-O-butyl cyclohexane-1,2-dicarboxylate |
| PubChem CID | 67113211 |
| Molecular Formula | C19H26O4 |
| Molecular Weight | 318.41 g/mol |
| Exact Mass | 318.18 |
| IUPAC Name | 2-O-benzyl 1-O-butyl cyclohexane-1,2-dicarboxylate |
| SMILES | CCCCOC(=O)C1CCCCC1C(=O)OCc1ccccc1 |
| InChI | InChI=1S/C19H26O4/c1-2-3-13-22-18(20)16-11-7-8-12-17(16)19(21)23-14-15-9-5-4-6-10-15/h4-6,9-10,16-17H,2-3,7-8,11-14H2,1H3 |
| InChIKey | AUJGRANHLVYNRP-UHFFFAOYSA-N |
| XLogP | 3.88 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 318.41 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 2-O-benzyl 1-O-butyl cyclohexane-1,2-dicarboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-O-benzyl 1-O-butyl cyclohexane-1,2-dicarboxylate?
The IUPAC name of 2-O-benzyl 1-O-butyl cyclohexane-1,2-dicarboxylate (CID 67113211) is 2-O-benzyl 1-O-butyl cyclohexane-1,2-dicarboxylate.
What is the SMILES notation for 2-O-benzyl 1-O-butyl cyclohexane-1,2-dicarboxylate?
The canonical SMILES for 2-O-benzyl 1-O-butyl cyclohexane-1,2-dicarboxylate is CCCCOC(=O)C1CCCCC1C(=O)OCc1ccccc1.
What is the InChIKey of 2-O-benzyl 1-O-butyl cyclohexane-1,2-dicarboxylate?
The InChIKey is AUJGRANHLVYNRP-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H26O4/c1-2-3-13-22-18(20)16-11-7-8-12-17(16)19(21)23-14-15-9-5-4-6-10-15/h4-6,9-10,16-17H,2-3,7-8,11-14H2,1H3.
What are the key properties of 2-O-benzyl 1-O-butyl cyclohexane-1,2-dicarboxylate?
2-O-benzyl 1-O-butyl cyclohexane-1,2-dicarboxylate has a molecular weight of 318.41 g/mol, XLogP of 3.88, 7 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-O-benzyl 1-O-butyl cyclohexane-1,2-dicarboxylate is sourced from PubChem (CID 67113211), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).