C25H24N4O3 — CID 67113330
N-[4-(5-hydroxyindazol-1-yl)phenyl]-4-(4-hydroxypiperidin-1-yl)benzamide (PubChem CID 67113330) has the molecular formula C25H24N4O3 and a molecular weight of 428.49 g/mol. Its IUPAC name is N-[4-(5-hydroxyindazol-1-yl)phenyl]-4-(4-hydroxypiperidin-1-yl)benzamide.
| Compound Name | N-[4-(5-hydroxyindazol-1-yl)phenyl]-4-(4-hydroxypiperidin-1-yl)benzamide |
|---|---|
| PubChem CID | 67113330 |
| Molecular Formula | C25H24N4O3 |
| Molecular Weight | 428.49 g/mol |
| Exact Mass | 428.18 |
| IUPAC Name | N-[4-(5-hydroxyindazol-1-yl)phenyl]-4-(4-hydroxypiperidin-1-yl)benzamide |
| SMILES | O=C(Nc1ccc(-n2ncc3cc(O)ccc32)cc1)c1ccc(N2CCC(O)CC2)cc1 |
| InChI | InChI=1S/C25H24N4O3/c30-22-11-13-28(14-12-22)20-5-1-17(2-6-20)25(32)27-19-3-7-21(8-4-19)29-24-10-9-23(31)15-18(24)16-26-29/h1-10,15-16,22,30-31H,11-14H2,(H,27,32) |
| InChIKey | JHMJVPRHHPSXNL-UHFFFAOYSA-N |
| XLogP | 3.94 |
| TPSA | 90.62 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.49 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |