C11H20O2 — CID 6711344
(1S,6S,8aS)-8a-methyl-2,3,4,4a,5,6,7,8-octahydro-1H-naphthalene-1,6-diol (PubChem CID 6711344) has the molecular formula C11H20O2 and a molecular weight of 184.28 g/mol. Its IUPAC name is (1S,6S,8aS)-8a-methyl-2,3,4,4a,5,6,7,8-octahydro-1H-naphthalene-1,6-diol.
| Compound Name | (1S,6S,8aS)-8a-methyl-2,3,4,4a,5,6,7,8-octahydro-1H-naphthalene-1,6-diol |
|---|---|
| PubChem CID | 6711344 |
| Molecular Formula | C11H20O2 |
| Molecular Weight | 184.28 g/mol |
| Exact Mass | 184.15 |
| IUPAC Name | (1S,6S,8aS)-8a-methyl-2,3,4,4a,5,6,7,8-octahydro-1H-naphthalene-1,6-diol |
| SMILES | C[C@]12CC[C@H](O)CC1CCC[C@@H]2O |
| InChI | InChI=1S/C11H20O2/c1-11-6-5-9(12)7-8(11)3-2-4-10(11)13/h8-10,12-13H,2-7H2,1H3/t8?,9-,10-,11-/m0/s1 |
| InChIKey | MPZJXFSZLAPMGN-KQFSYOIOSA-N |
| XLogP | 1.70 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 184.28 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |