C34H62OSi — CID 6711345
tert-butyl-[[(3S,8R,10S,13R)-17-[(2R,5S)-5,6-dimethylheptan-2-yl]-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl]oxy]-dimethylsilane (PubChem CID 6711345) has the molecular formula C34H62OSi and a molecular weight of 514.96 g/mol. Its IUPAC name is tert-butyl-[[(3S,8R,10S,13R)-17-[(2R,5S)-5,6-dimethylheptan-2-yl]-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl]oxy]-dimethylsilane.
| Compound Name | tert-butyl-[[(3S,8R,10S,13R)-17-[(2R,5S)-5,6-dimethylheptan-2-yl]-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl]oxy]-dimethylsilane |
|---|---|
| PubChem CID | 6711345 |
| Molecular Formula | C34H62OSi |
| Molecular Weight | 514.96 g/mol |
| Exact Mass | 514.46 |
| IUPAC Name | tert-butyl-[[(3S,8R,10S,13R)-17-[(2R,5S)-5,6-dimethylheptan-2-yl]-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl]oxy]-dimethylsilane |
| SMILES | CC(C)[C@@H](C)CC[C@@H](C)C1CC=C2[C@@H]3CCC4C[C@@H](O[Si](C)(C)C(C)(C)C)CC[C@]4(C)C3CC[C@@]21C |
| InChI | InChI=1S/C34H62OSi/c1-23(2)24(3)12-13-25(4)29-16-17-30-28-15-14-26-22-27(35-36(10,11)32(5,6)7)18-20-33(26,8)31(28)19-21-34(29,30)9/h17,23-29,31H,12-16,18-22H2,1-11H3/t24-,25+,26?,27-,28-,29?,31?,33-,34+/m0/s1 |
| InChIKey | ZDHZLSKPLHWFMW-MWCBHAHUSA-N |
| XLogP | 10.66 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.96 |
| LogP ≤ 5 | 10.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|