C24H25NO4 — CID 67113561
(4R)-4-benzyl-3-[(E,2S,3S)-3-hydroxy-5-phenyl-2-prop-2-enylpent-4-enoyl]-1,3-oxazolidin-2-one (PubChem CID 67113561) has the molecular formula C24H25NO4 and a molecular weight of 391.47 g/mol. Its IUPAC name is (4R)-4-benzyl-3-[(E,2S,3S)-3-hydroxy-5-phenyl-2-prop-2-enylpent-4-enoyl]-1,3-oxazolidin-2-one.
| Compound Name | (4R)-4-benzyl-3-[(E,2S,3S)-3-hydroxy-5-phenyl-2-prop-2-enylpent-4-enoyl]-1,3-oxazolidin-2-one |
|---|---|
| PubChem CID | 67113561 |
| Molecular Formula | C24H25NO4 |
| Molecular Weight | 391.47 g/mol |
| Exact Mass | 391.18 |
| IUPAC Name | (4R)-4-benzyl-3-[(E,2S,3S)-3-hydroxy-5-phenyl-2-prop-2-enylpent-4-enoyl]-1,3-oxazolidin-2-one |
| SMILES | C=CC[C@H](C(=O)N1C(=O)OC[C@H]1Cc1ccccc1)[C@@H](O)/C=C/c1ccccc1 |
| InChI | InChI=1S/C24H25NO4/c1-2-9-21(22(26)15-14-18-10-5-3-6-11-18)23(27)25-20(17-29-24(25)28)16-19-12-7-4-8-13-19/h2-8,10-15,20-22,26H,1,9,16-17H2/b15-14+/t20-,21+,22+/m1/s1 |
| InChIKey | RVBZFFHFANTNEB-GBFBBKFMSA-N |
| XLogP | 3.84 |
| TPSA | 66.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.47 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|