About 2-tert-butyl-2,3-dimethyl-4-oxopiperidine-1-carboxylic acid
2-tert-butyl-2,3-dimethyl-4-oxopiperidine-1-carboxylic acid (PubChem CID 67113594) has the molecular formula C12H21NO3
and a molecular weight of 227.30 g/mol. Its IUPAC name is 2-tert-butyl-2,3-dimethyl-4-oxopiperidine-1-carboxylic acid.
Molecular Properties
| Compound Name | 2-tert-butyl-2,3-dimethyl-4-oxopiperidine-1-carboxylic acid |
| PubChem CID | 67113594 |
| Molecular Formula | C12H21NO3 |
| Molecular Weight | 227.30 g/mol |
| Exact Mass | 227.15 |
| IUPAC Name | 2-tert-butyl-2,3-dimethyl-4-oxopiperidine-1-carboxylic acid |
| SMILES | CC1C(=O)CCN(C(=O)O)C1(C)C(C)(C)C |
| InChI | InChI=1S/C12H21NO3/c1-8-9(14)6-7-13(10(15)16)12(8,5)11(2,3)4/h8H,6-7H2,1-5H3,(H,15,16) |
| InChIKey | RWTIUJVZMJJUID-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 227.30 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-tert-butyl-2,3-dimethyl-4-oxopiperidine-1-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-tert-butyl-2,3-dimethyl-4-oxopiperidine-1-carboxylic acid?
The IUPAC name of 2-tert-butyl-2,3-dimethyl-4-oxopiperidine-1-carboxylic acid (CID 67113594) is 2-tert-butyl-2,3-dimethyl-4-oxopiperidine-1-carboxylic acid.
What is the SMILES notation for 2-tert-butyl-2,3-dimethyl-4-oxopiperidine-1-carboxylic acid?
The canonical SMILES for 2-tert-butyl-2,3-dimethyl-4-oxopiperidine-1-carboxylic acid is CC1C(=O)CCN(C(=O)O)C1(C)C(C)(C)C.
What is the InChIKey of 2-tert-butyl-2,3-dimethyl-4-oxopiperidine-1-carboxylic acid?
The InChIKey is RWTIUJVZMJJUID-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H21NO3/c1-8-9(14)6-7-13(10(15)16)12(8,5)11(2,3)4/h8H,6-7H2,1-5H3,(H,15,16).
What are the key properties of 2-tert-butyl-2,3-dimethyl-4-oxopiperidine-1-carboxylic acid?
2-tert-butyl-2,3-dimethyl-4-oxopiperidine-1-carboxylic acid has a molecular weight of 227.30 g/mol, XLogP of 2.38, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-tert-butyl-2,3-dimethyl-4-oxopiperidine-1-carboxylic acid is sourced from PubChem (CID 67113594), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).