2-tert-butyl-2,3-dimethyl-4-oxopiperidine-1-carboxylic acid

C12H21NO3 — CID 67113594

IUPAC2-tert-butyl-2,3-dimethyl-4-oxopiperidine-1-carboxylic acid
SMILESCC1C(=O)CCN(C(=O)O)C1(C)C(C)(C)C
InChIInChI=1S/C12H21NO3/c1-8-9(14)6-7-13(10(15)16)12(8,5)11(2,3)4/h8H,6-7H2,1-5H3,(H,15,16)
InChIKeyRWTIUJVZMJJUID-UHFFFAOYSA-N
MW227.30 g/mol
LogP2.38
Rot. Bonds

About 2-tert-butyl-2,3-dimethyl-4-oxopiperidine-1-carboxylic acid

2-tert-butyl-2,3-dimethyl-4-oxopiperidine-1-carboxylic acid (PubChem CID 67113594) has the molecular formula C12H21NO3 and a molecular weight of 227.30 g/mol. Its IUPAC name is 2-tert-butyl-2,3-dimethyl-4-oxopiperidine-1-carboxylic acid.

Molecular Properties

Compound Name2-tert-butyl-2,3-dimethyl-4-oxopiperidine-1-carboxylic acid
PubChem CID67113594
Molecular FormulaC12H21NO3
Molecular Weight227.30 g/mol
Exact Mass227.15
IUPAC Name2-tert-butyl-2,3-dimethyl-4-oxopiperidine-1-carboxylic acid
SMILESCC1C(=O)CCN(C(=O)O)C1(C)C(C)(C)C
InChIInChI=1S/C12H21NO3/c1-8-9(14)6-7-13(10(15)16)12(8,5)11(2,3)4/h8H,6-7H2,1-5H3,(H,15,16)
InChIKeyRWTIUJVZMJJUID-UHFFFAOYSA-N
XLogP2.38
TPSA57.61 Ų
H-Bond Donors1
H-Bond Acceptors2
Rotatable Bonds
Heavy Atoms16
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500227.30
LogP ≤ 52.38
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 102

Analyze 2-tert-butyl-2,3-dimethyl-4-oxopiperidine-1-carboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-tert-butyl-2,3-dimethyl-4-oxopiperidine-1-carboxylic acid?
The IUPAC name of 2-tert-butyl-2,3-dimethyl-4-oxopiperidine-1-carboxylic acid (CID 67113594) is 2-tert-butyl-2,3-dimethyl-4-oxopiperidine-1-carboxylic acid.
What is the SMILES notation for 2-tert-butyl-2,3-dimethyl-4-oxopiperidine-1-carboxylic acid?
The canonical SMILES for 2-tert-butyl-2,3-dimethyl-4-oxopiperidine-1-carboxylic acid is CC1C(=O)CCN(C(=O)O)C1(C)C(C)(C)C.
What is the InChIKey of 2-tert-butyl-2,3-dimethyl-4-oxopiperidine-1-carboxylic acid?
The InChIKey is RWTIUJVZMJJUID-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H21NO3/c1-8-9(14)6-7-13(10(15)16)12(8,5)11(2,3)4/h8H,6-7H2,1-5H3,(H,15,16).
What are the key properties of 2-tert-butyl-2,3-dimethyl-4-oxopiperidine-1-carboxylic acid?
2-tert-butyl-2,3-dimethyl-4-oxopiperidine-1-carboxylic acid has a molecular weight of 227.30 g/mol, XLogP of 2.38, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-tert-butyl-2,3-dimethyl-4-oxopiperidine-1-carboxylic acid is sourced from PubChem (CID 67113594), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).