About 9-chloro-2,2-dimethyl-5-(6-methylquinolin-3-yl)-3H-1,4-benzoxazepine
9-chloro-2,2-dimethyl-5-(6-methylquinolin-3-yl)-3H-1,4-benzoxazepine (PubChem CID 67113901) has the molecular formula C21H19ClN2O
and a molecular weight of 350.85 g/mol. Its IUPAC name is 9-chloro-2,2-dimethyl-5-(6-methylquinolin-3-yl)-3H-1,4-benzoxazepine.
Molecular Properties
| Compound Name | 9-chloro-2,2-dimethyl-5-(6-methylquinolin-3-yl)-3H-1,4-benzoxazepine |
| PubChem CID | 67113901 |
| Molecular Formula | C21H19ClN2O |
| Molecular Weight | 350.85 g/mol |
| Exact Mass | 350.12 |
| IUPAC Name | 9-chloro-2,2-dimethyl-5-(6-methylquinolin-3-yl)-3H-1,4-benzoxazepine |
| SMILES | Cc1ccc2ncc(C3=NCC(C)(C)Oc4c(Cl)cccc43)cc2c1 |
| InChI | InChI=1S/C21H19ClN2O/c1-13-7-8-18-14(9-13)10-15(11-23-18)19-16-5-4-6-17(22)20(16)25-21(2,3)12-24-19/h4-11H,12H2,1-3H3 |
| InChIKey | KPEBDDJXTWVTOY-UHFFFAOYSA-N |
| XLogP | 5.21 |
| TPSA | 34.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 350.85 |
| LogP ≤ 5 | 5.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 9-chloro-2,2-dimethyl-5-(6-methylquinolin-3-yl)-3H-1,4-benzoxazepine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 9-chloro-2,2-dimethyl-5-(6-methylquinolin-3-yl)-3H-1,4-benzoxazepine?
The IUPAC name of 9-chloro-2,2-dimethyl-5-(6-methylquinolin-3-yl)-3H-1,4-benzoxazepine (CID 67113901) is 9-chloro-2,2-dimethyl-5-(6-methylquinolin-3-yl)-3H-1,4-benzoxazepine.
What is the SMILES notation for 9-chloro-2,2-dimethyl-5-(6-methylquinolin-3-yl)-3H-1,4-benzoxazepine?
The canonical SMILES for 9-chloro-2,2-dimethyl-5-(6-methylquinolin-3-yl)-3H-1,4-benzoxazepine is Cc1ccc2ncc(C3=NCC(C)(C)Oc4c(Cl)cccc43)cc2c1.
What is the InChIKey of 9-chloro-2,2-dimethyl-5-(6-methylquinolin-3-yl)-3H-1,4-benzoxazepine?
The InChIKey is KPEBDDJXTWVTOY-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H19ClN2O/c1-13-7-8-18-14(9-13)10-15(11-23-18)19-16-5-4-6-17(22)20(16)25-21(2,3)12-24-19/h4-11H,12H2,1-3H3.
What are the key properties of 9-chloro-2,2-dimethyl-5-(6-methylquinolin-3-yl)-3H-1,4-benzoxazepine?
9-chloro-2,2-dimethyl-5-(6-methylquinolin-3-yl)-3H-1,4-benzoxazepine has a molecular weight of 350.85 g/mol, XLogP of 5.21, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 9-chloro-2,2-dimethyl-5-(6-methylquinolin-3-yl)-3H-1,4-benzoxazepine is sourced from PubChem (CID 67113901), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).