C18H16BNO2 — CID 6711458
2-methyl-8,8-diphenyl-7,9-dioxa-3-azonia-8-boranuidabicyclo[4.3.0]nona-1(6),2,4-triene (PubChem CID 6711458) has the molecular formula C18H16BNO2 and a molecular weight of 289.14 g/mol. Its IUPAC name is 2-methyl-8,8-diphenyl-7,9-dioxa-3-azonia-8-boranuidabicyclo[4.3.0]nona-1(6),2,4-triene.
| Compound Name | 2-methyl-8,8-diphenyl-7,9-dioxa-3-azonia-8-boranuidabicyclo[4.3.0]nona-1(6),2,4-triene |
|---|---|
| PubChem CID | 6711458 |
| Molecular Formula | C18H16BNO2 |
| Molecular Weight | 289.14 g/mol |
| Exact Mass | 289.13 |
| IUPAC Name | 2-methyl-8,8-diphenyl-7,9-dioxa-3-azonia-8-boranuidabicyclo[4.3.0]nona-1(6),2,4-triene |
| SMILES | Cc1[nH+]ccc2c1O[B-](c1ccccc1)(c1ccccc1)O2 |
| InChI | InChI=1S/C18H15BNO2/c1-14-18-17(12-13-20-14)21-19(22-18,15-8-4-2-5-9-15)16-10-6-3-7-11-16/h2-13H,1H3/q-1/p+1 |
| InChIKey | NYPMKQWFNMPSMO-UHFFFAOYSA-O |
| XLogP | 1.84 |
| TPSA | 32.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.14 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|