C13H18N4O — CID 67114778
2-amino-5-[(1S,4S)-5-methyl-2,5-diazabicyclo[2.2.1]heptan-2-yl]benzamide (PubChem CID 67114778) has the molecular formula C13H18N4O and a molecular weight of 246.31 g/mol. Its IUPAC name is 2-amino-5-[(1S,4S)-5-methyl-2,5-diazabicyclo[2.2.1]heptan-2-yl]benzamide.
| Compound Name | 2-amino-5-[(1S,4S)-5-methyl-2,5-diazabicyclo[2.2.1]heptan-2-yl]benzamide |
|---|---|
| PubChem CID | 67114778 |
| Molecular Formula | C13H18N4O |
| Molecular Weight | 246.31 g/mol |
| Exact Mass | 246.15 |
| IUPAC Name | 2-amino-5-[(1S,4S)-5-methyl-2,5-diazabicyclo[2.2.1]heptan-2-yl]benzamide |
| SMILES | CN1C[C@@H]2C[C@H]1CN2c1ccc(N)c(C(N)=O)c1 |
| InChI | InChI=1S/C13H18N4O/c1-16-6-10-4-9(16)7-17(10)8-2-3-12(14)11(5-8)13(15)18/h2-3,5,9-10H,4,6-7,14H2,1H3,(H2,15,18)/t9-,10-/m0/s1 |
| InChIKey | UMVPHALOKJMKDQ-UWVGGRQHSA-N |
| XLogP | 0.26 |
| TPSA | 75.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.31 |
| LogP ≤ 5 | 0.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|