About 3-chloro-7-nitro-1-oxido-1,2,4-benzotriazin-1-ium
3-chloro-7-nitro-1-oxido-1,2,4-benzotriazin-1-ium (PubChem CID 6711496) has the molecular formula C7H3ClN4O3
and a molecular weight of 226.58 g/mol. Its IUPAC name is 3-chloro-7-nitro-1-oxido-1,2,4-benzotriazin-1-ium.
Molecular Properties
| Compound Name | 3-chloro-7-nitro-1-oxido-1,2,4-benzotriazin-1-ium |
| PubChem CID | 6711496 |
| Molecular Formula | C7H3ClN4O3 |
| Molecular Weight | 226.58 g/mol |
| Exact Mass | 225.99 |
| IUPAC Name | 3-chloro-7-nitro-1-oxido-1,2,4-benzotriazin-1-ium |
| SMILES | O=[N+]([O-])c1ccc2nc(Cl)n[n+]([O-])c2c1 |
| InChI | InChI=1S/C7H3ClN4O3/c8-7-9-5-2-1-4(12(14)15)3-6(5)11(13)10-7/h1-3H |
| InChIKey | ZJLUWASPMQAXOJ-UHFFFAOYSA-N |
| XLogP | 0.82 |
| TPSA | 95.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 226.58 |
| LogP ≤ 5 | 0.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'N_oxide', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|
Analyze 3-chloro-7-nitro-1-oxido-1,2,4-benzotriazin-1-ium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-chloro-7-nitro-1-oxido-1,2,4-benzotriazin-1-ium?
The IUPAC name of 3-chloro-7-nitro-1-oxido-1,2,4-benzotriazin-1-ium (CID 6711496) is 3-chloro-7-nitro-1-oxido-1,2,4-benzotriazin-1-ium.
What is the SMILES notation for 3-chloro-7-nitro-1-oxido-1,2,4-benzotriazin-1-ium?
The canonical SMILES for 3-chloro-7-nitro-1-oxido-1,2,4-benzotriazin-1-ium is O=[N+]([O-])c1ccc2nc(Cl)n[n+]([O-])c2c1.
What is the InChIKey of 3-chloro-7-nitro-1-oxido-1,2,4-benzotriazin-1-ium?
The InChIKey is ZJLUWASPMQAXOJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H3ClN4O3/c8-7-9-5-2-1-4(12(14)15)3-6(5)11(13)10-7/h1-3H.
What are the key properties of 3-chloro-7-nitro-1-oxido-1,2,4-benzotriazin-1-ium?
3-chloro-7-nitro-1-oxido-1,2,4-benzotriazin-1-ium has a molecular weight of 226.58 g/mol, XLogP of 0.82, 1 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-chloro-7-nitro-1-oxido-1,2,4-benzotriazin-1-ium is sourced from PubChem (CID 6711496), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).