About 2-[(2R)-2-(2,3-difluorophenyl)-2-hydroxyacetyl]oxy-6-hydroxybenzoic acid
2-[(2R)-2-(2,3-difluorophenyl)-2-hydroxyacetyl]oxy-6-hydroxybenzoic acid (PubChem CID 67115122) has the molecular formula C15H10F2O6
and a molecular weight of 324.24 g/mol. Its IUPAC name is 2-[(2R)-2-(2,3-difluorophenyl)-2-hydroxyacetyl]oxy-6-hydroxybenzoic acid.
Molecular Properties
| Compound Name | 2-[(2R)-2-(2,3-difluorophenyl)-2-hydroxyacetyl]oxy-6-hydroxybenzoic acid |
| PubChem CID | 67115122 |
| Molecular Formula | C15H10F2O6 |
| Molecular Weight | 324.24 g/mol |
| Exact Mass | 324.04 |
| IUPAC Name | 2-[(2R)-2-(2,3-difluorophenyl)-2-hydroxyacetyl]oxy-6-hydroxybenzoic acid |
| SMILES | O=C(O)c1c(O)cccc1OC(=O)[C@H](O)c1cccc(F)c1F |
| InChI | InChI=1S/C15H10F2O6/c16-8-4-1-3-7(12(8)17)13(19)15(22)23-10-6-2-5-9(18)11(10)14(20)21/h1-6,13,18-19H,(H,20,21)/t13-/m1/s1 |
| InChIKey | XXKVTCOWCUSFCP-CYBMUJFWSA-N |
| XLogP | 2.01 |
| TPSA | 104.06 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 324.24 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|
Analyze 2-[(2R)-2-(2,3-difluorophenyl)-2-hydroxyacetyl]oxy-6-hydroxybenzoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(2R)-2-(2,3-difluorophenyl)-2-hydroxyacetyl]oxy-6-hydroxybenzoic acid?
The IUPAC name of 2-[(2R)-2-(2,3-difluorophenyl)-2-hydroxyacetyl]oxy-6-hydroxybenzoic acid (CID 67115122) is 2-[(2R)-2-(2,3-difluorophenyl)-2-hydroxyacetyl]oxy-6-hydroxybenzoic acid.
What is the SMILES notation for 2-[(2R)-2-(2,3-difluorophenyl)-2-hydroxyacetyl]oxy-6-hydroxybenzoic acid?
The canonical SMILES for 2-[(2R)-2-(2,3-difluorophenyl)-2-hydroxyacetyl]oxy-6-hydroxybenzoic acid is O=C(O)c1c(O)cccc1OC(=O)[C@H](O)c1cccc(F)c1F.
What is the InChIKey of 2-[(2R)-2-(2,3-difluorophenyl)-2-hydroxyacetyl]oxy-6-hydroxybenzoic acid?
The InChIKey is XXKVTCOWCUSFCP-CYBMUJFWSA-N. The full InChI is InChI=1S/C15H10F2O6/c16-8-4-1-3-7(12(8)17)13(19)15(22)23-10-6-2-5-9(18)11(10)14(20)21/h1-6,13,18-19H,(H,20,21)/t13-/m1/s1.
What are the key properties of 2-[(2R)-2-(2,3-difluorophenyl)-2-hydroxyacetyl]oxy-6-hydroxybenzoic acid?
2-[(2R)-2-(2,3-difluorophenyl)-2-hydroxyacetyl]oxy-6-hydroxybenzoic acid has a molecular weight of 324.24 g/mol, XLogP of 2.01, 4 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(2R)-2-(2,3-difluorophenyl)-2-hydroxyacetyl]oxy-6-hydroxybenzoic acid is sourced from PubChem (CID 67115122), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).