C21H24N8O5S2 — CID 67115469
6-amino-8-[[6-(5-methylfuran-2-yl)-1,3-benzodioxol-5-yl]sulfanyl]-9-[2-[2-(sulfamoylamino)ethylamino]ethyl]purine (PubChem CID 67115469) has the molecular formula C21H24N8O5S2 and a molecular weight of 532.61 g/mol. Its IUPAC name is 6-amino-8-[[6-(5-methylfuran-2-yl)-1,3-benzodioxol-5-yl]sulfanyl]-9-[2-[2-(sulfamoylamino)ethylamino]ethyl]purine.
| Compound Name | 6-amino-8-[[6-(5-methylfuran-2-yl)-1,3-benzodioxol-5-yl]sulfanyl]-9-[2-[2-(sulfamoylamino)ethylamino]ethyl]purine |
|---|---|
| PubChem CID | 67115469 |
| Molecular Formula | C21H24N8O5S2 |
| Molecular Weight | 532.61 g/mol |
| Exact Mass | 532.13 |
| IUPAC Name | 6-amino-8-[[6-(5-methylfuran-2-yl)-1,3-benzodioxol-5-yl]sulfanyl]-9-[2-[2-(sulfamoylamino)ethylamino]ethyl]purine |
| SMILES | Cc1ccc(-c2cc3c(cc2Sc2nc4c(N)ncnc4n2CCNCCNS(N)(=O)=O)OCO3)o1 |
| InChI | InChI=1S/C21H24N8O5S2/c1-12-2-3-14(34-12)13-8-15-16(33-11-32-15)9-17(13)35-21-28-18-19(22)25-10-26-20(18)29(21)7-6-24-4-5-27-36(23,30)31/h2-3,8-10,24,27H,4-7,11H2,1H3,(H2,22,25,26)(H2,23,30,31) |
| InChIKey | LYNZXCNJPUCCLG-UHFFFAOYSA-N |
| XLogP | 1.24 |
| TPSA | 185.44 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.61 |
| LogP ≤ 5 | 1.24 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|