C22H23N7O4S — CID 67115546
6-[6-amino-8-[[6-(5-methyl-1,3-oxazol-2-yl)-1,3-benzodioxol-5-yl]sulfanyl]purin-9-yl]hexanamide (PubChem CID 67115546) has the molecular formula C22H23N7O4S and a molecular weight of 481.54 g/mol. Its IUPAC name is 6-[6-amino-8-[[6-(5-methyl-1,3-oxazol-2-yl)-1,3-benzodioxol-5-yl]sulfanyl]purin-9-yl]hexanamide.
| Compound Name | 6-[6-amino-8-[[6-(5-methyl-1,3-oxazol-2-yl)-1,3-benzodioxol-5-yl]sulfanyl]purin-9-yl]hexanamide |
|---|---|
| PubChem CID | 67115546 |
| Molecular Formula | C22H23N7O4S |
| Molecular Weight | 481.54 g/mol |
| Exact Mass | 481.15 |
| IUPAC Name | 6-[6-amino-8-[[6-(5-methyl-1,3-oxazol-2-yl)-1,3-benzodioxol-5-yl]sulfanyl]purin-9-yl]hexanamide |
| SMILES | Cc1cnc(-c2cc3c(cc2Sc2nc4c(N)ncnc4n2CCCCCC(N)=O)OCO3)o1 |
| InChI | InChI=1S/C22H23N7O4S/c1-12-9-25-21(33-12)13-7-14-15(32-11-31-14)8-16(13)34-22-28-18-19(24)26-10-27-20(18)29(22)6-4-2-3-5-17(23)30/h7-10H,2-6,11H2,1H3,(H2,23,30)(H2,24,26,27) |
| InChIKey | BXSQLNUZZYMVDL-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 157.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.54 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|