C10H14O2 — CID 6711561
2-[(1R,3aS,6aS)-2-oxo-3,3a,4,5,6,6a-hexahydro-1H-pentalen-1-yl]acetaldehyde (PubChem CID 6711561) has the molecular formula C10H14O2 and a molecular weight of 166.22 g/mol. Its IUPAC name is 2-[(1R,3aS,6aS)-2-oxo-3,3a,4,5,6,6a-hexahydro-1H-pentalen-1-yl]acetaldehyde.
| Compound Name | 2-[(1R,3aS,6aS)-2-oxo-3,3a,4,5,6,6a-hexahydro-1H-pentalen-1-yl]acetaldehyde |
|---|---|
| PubChem CID | 6711561 |
| Molecular Formula | C10H14O2 |
| Molecular Weight | 166.22 g/mol |
| Exact Mass | 166.10 |
| IUPAC Name | 2-[(1R,3aS,6aS)-2-oxo-3,3a,4,5,6,6a-hexahydro-1H-pentalen-1-yl]acetaldehyde |
| SMILES | O=CC[C@H]1C(=O)C[C@@H]2CCC[C@@H]21 |
| InChI | InChI=1S/C10H14O2/c11-5-4-9-8-3-1-2-7(8)6-10(9)12/h5,7-9H,1-4,6H2/t7-,8-,9+/m0/s1 |
| InChIKey | CXUWTFVRSNMVAF-XHNCKOQMSA-N |
| XLogP | 1.58 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 166.22 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|