C21H24N8O2S — CID 67115633
9-[3-(propan-2-ylamino)propyl]-8-[[6-(1H-pyrazol-5-yl)-1,3-benzodioxol-5-yl]sulfanyl]purin-6-amine (PubChem CID 67115633) has the molecular formula C21H24N8O2S and a molecular weight of 452.54 g/mol. Its IUPAC name is 9-[3-(propan-2-ylamino)propyl]-8-[[6-(1H-pyrazol-5-yl)-1,3-benzodioxol-5-yl]sulfanyl]purin-6-amine.
| Compound Name | 9-[3-(propan-2-ylamino)propyl]-8-[[6-(1H-pyrazol-5-yl)-1,3-benzodioxol-5-yl]sulfanyl]purin-6-amine |
|---|---|
| PubChem CID | 67115633 |
| Molecular Formula | C21H24N8O2S |
| Molecular Weight | 452.54 g/mol |
| Exact Mass | 452.17 |
| IUPAC Name | 9-[3-(propan-2-ylamino)propyl]-8-[[6-(1H-pyrazol-5-yl)-1,3-benzodioxol-5-yl]sulfanyl]purin-6-amine |
| SMILES | CC(C)NCCCn1c(Sc2cc3c(cc2-c2ccn[nH]2)OCO3)nc2c(N)ncnc21 |
| InChI | InChI=1S/C21H24N8O2S/c1-12(2)23-5-3-7-29-20-18(19(22)24-10-25-20)27-21(29)32-17-9-16-15(30-11-31-16)8-13(17)14-4-6-26-28-14/h4,6,8-10,12,23H,3,5,7,11H2,1-2H3,(H,26,28)(H2,22,24,25) |
| InChIKey | GBDUXJSWSYSYPX-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 128.79 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.54 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|