C22H24FN7O3 — CID 67115739
2-fluoro-9-[2-(2-methylpropylamino)ethyl]-8-[[6-(1,3-oxazol-2-yl)-1,3-benzodioxol-5-yl]methyl]purin-6-amine (PubChem CID 67115739) has the molecular formula C22H24FN7O3 and a molecular weight of 453.48 g/mol. Its IUPAC name is 2-fluoro-9-[2-(2-methylpropylamino)ethyl]-8-[[6-(1,3-oxazol-2-yl)-1,3-benzodioxol-5-yl]methyl]purin-6-amine.
| Compound Name | 2-fluoro-9-[2-(2-methylpropylamino)ethyl]-8-[[6-(1,3-oxazol-2-yl)-1,3-benzodioxol-5-yl]methyl]purin-6-amine |
|---|---|
| PubChem CID | 67115739 |
| Molecular Formula | C22H24FN7O3 |
| Molecular Weight | 453.48 g/mol |
| Exact Mass | 453.19 |
| IUPAC Name | 2-fluoro-9-[2-(2-methylpropylamino)ethyl]-8-[[6-(1,3-oxazol-2-yl)-1,3-benzodioxol-5-yl]methyl]purin-6-amine |
| SMILES | CC(C)CNCCn1c(Cc2cc3c(cc2-c2ncco2)OCO3)nc2c(N)nc(F)nc21 |
| InChI | InChI=1S/C22H24FN7O3/c1-12(2)10-25-3-5-30-17(27-18-19(24)28-22(23)29-20(18)30)8-13-7-15-16(33-11-32-15)9-14(13)21-26-4-6-31-21/h4,6-7,9,12,25H,3,5,8,10-11H2,1-2H3,(H2,24,28,29) |
| InChIKey | ZSJUKJWAPUMIJT-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 126.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.48 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|