About 5-[[(1R,2S)-2-phenylcyclopropyl]amino]pentanamide;hydrochloride
5-[[(1R,2S)-2-phenylcyclopropyl]amino]pentanamide;hydrochloride (PubChem CID 67115781) has the molecular formula C14H21ClN2O
and a molecular weight of 268.79 g/mol. Its IUPAC name is 5-[[(1R,2S)-2-phenylcyclopropyl]amino]pentanamide;hydrochloride.
Molecular Properties
| Compound Name | 5-[[(1R,2S)-2-phenylcyclopropyl]amino]pentanamide;hydrochloride |
| PubChem CID | 67115781 |
| Molecular Formula | C14H21ClN2O |
| Molecular Weight | 268.79 g/mol |
| Exact Mass | 268.13 |
| IUPAC Name | 5-[[(1R,2S)-2-phenylcyclopropyl]amino]pentanamide;hydrochloride |
| SMILES | Cl.NC(=O)CCCCN[C@@H]1C[C@H]1c1ccccc1 |
| InChI | InChI=1S/C14H20N2O.ClH/c15-14(17)8-4-5-9-16-13-10-12(13)11-6-2-1-3-7-11;/h1-3,6-7,12-13,16H,4-5,8-10H2,(H2,15,17);1H/t12-,13+;/m0./s1 |
| InChIKey | SIQWVIGTZVCYHO-JHEYCYPBSA-N |
| XLogP | 2.21 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 268.79 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 5-[[(1R,2S)-2-phenylcyclopropyl]amino]pentanamide;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-[[(1R,2S)-2-phenylcyclopropyl]amino]pentanamide;hydrochloride?
The IUPAC name of 5-[[(1R,2S)-2-phenylcyclopropyl]amino]pentanamide;hydrochloride (CID 67115781) is 5-[[(1R,2S)-2-phenylcyclopropyl]amino]pentanamide;hydrochloride.
What is the SMILES notation for 5-[[(1R,2S)-2-phenylcyclopropyl]amino]pentanamide;hydrochloride?
The canonical SMILES for 5-[[(1R,2S)-2-phenylcyclopropyl]amino]pentanamide;hydrochloride is Cl.NC(=O)CCCCN[C@@H]1C[C@H]1c1ccccc1.
What is the InChIKey of 5-[[(1R,2S)-2-phenylcyclopropyl]amino]pentanamide;hydrochloride?
The InChIKey is SIQWVIGTZVCYHO-JHEYCYPBSA-N. The full InChI is InChI=1S/C14H20N2O.ClH/c15-14(17)8-4-5-9-16-13-10-12(13)11-6-2-1-3-7-11;/h1-3,6-7,12-13,16H,4-5,8-10H2,(H2,15,17);1H/t12-,13+;/m0./s1.
What are the key properties of 5-[[(1R,2S)-2-phenylcyclopropyl]amino]pentanamide;hydrochloride?
5-[[(1R,2S)-2-phenylcyclopropyl]amino]pentanamide;hydrochloride has a molecular weight of 268.79 g/mol, XLogP of 2.21, 7 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5-[[(1R,2S)-2-phenylcyclopropyl]amino]pentanamide;hydrochloride is sourced from PubChem (CID 67115781), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).