C23H25N7OS2 — CID 67115828
9-[2-(2,2-dimethylpropylamino)ethyl]-8-[[5-(furan-2-yl)-1,3-benzothiazol-6-yl]sulfanyl]purin-6-amine (PubChem CID 67115828) has the molecular formula C23H25N7OS2 and a molecular weight of 479.64 g/mol. Its IUPAC name is 9-[2-(2,2-dimethylpropylamino)ethyl]-8-[[5-(furan-2-yl)-1,3-benzothiazol-6-yl]sulfanyl]purin-6-amine.
| Compound Name | 9-[2-(2,2-dimethylpropylamino)ethyl]-8-[[5-(furan-2-yl)-1,3-benzothiazol-6-yl]sulfanyl]purin-6-amine |
|---|---|
| PubChem CID | 67115828 |
| Molecular Formula | C23H25N7OS2 |
| Molecular Weight | 479.64 g/mol |
| Exact Mass | 479.16 |
| IUPAC Name | 9-[2-(2,2-dimethylpropylamino)ethyl]-8-[[5-(furan-2-yl)-1,3-benzothiazol-6-yl]sulfanyl]purin-6-amine |
| SMILES | CC(C)(C)CNCCn1c(Sc2cc3scnc3cc2-c2ccco2)nc2c(N)ncnc21 |
| InChI | InChI=1S/C23H25N7OS2/c1-23(2,3)11-25-6-7-30-21-19(20(24)26-12-27-21)29-22(30)33-17-10-18-15(28-13-32-18)9-14(17)16-5-4-8-31-16/h4-5,8-10,12-13,25H,6-7,11H2,1-3H3,(H2,24,26,27) |
| InChIKey | UOINVTJREAYXCD-UHFFFAOYSA-N |
| XLogP | 5.07 |
| TPSA | 107.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.64 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|