C22H24FN7O5S — CID 67115870
5-[6-amino-2-fluoro-8-[[6-(5-methyl-1,3-oxazol-2-yl)-1,3-benzodioxol-5-yl]methyl]purin-9-yl]pentane-1-sulfonamide (PubChem CID 67115870) has the molecular formula C22H24FN7O5S and a molecular weight of 517.54 g/mol. Its IUPAC name is 5-[6-amino-2-fluoro-8-[[6-(5-methyl-1,3-oxazol-2-yl)-1,3-benzodioxol-5-yl]methyl]purin-9-yl]pentane-1-sulfonamide.
| Compound Name | 5-[6-amino-2-fluoro-8-[[6-(5-methyl-1,3-oxazol-2-yl)-1,3-benzodioxol-5-yl]methyl]purin-9-yl]pentane-1-sulfonamide |
|---|---|
| PubChem CID | 67115870 |
| Molecular Formula | C22H24FN7O5S |
| Molecular Weight | 517.54 g/mol |
| Exact Mass | 517.15 |
| IUPAC Name | 5-[6-amino-2-fluoro-8-[[6-(5-methyl-1,3-oxazol-2-yl)-1,3-benzodioxol-5-yl]methyl]purin-9-yl]pentane-1-sulfonamide |
| SMILES | Cc1cnc(-c2cc3c(cc2Cc2nc4c(N)nc(F)nc4n2CCCCCS(N)(=O)=O)OCO3)o1 |
| InChI | InChI=1S/C22H24FN7O5S/c1-12-10-26-21(35-12)14-9-16-15(33-11-34-16)7-13(14)8-17-27-18-19(24)28-22(23)29-20(18)30(17)5-3-2-4-6-36(25,31)32/h7,9-10H,2-6,8,11H2,1H3,(H2,24,28,29)(H2,25,31,32) |
| InChIKey | YFAKBGIUFCTLFS-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 174.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 517.54 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|