C25H28FN7O — CID 67115876
9-[2-(2,2-dimethylpropylamino)ethyl]-2-fluoro-8-[[6-(furan-2-yl)-1H-indol-5-yl]methyl]purin-6-amine (PubChem CID 67115876) has the molecular formula C25H28FN7O and a molecular weight of 461.55 g/mol. Its IUPAC name is 9-[2-(2,2-dimethylpropylamino)ethyl]-2-fluoro-8-[[6-(furan-2-yl)-1H-indol-5-yl]methyl]purin-6-amine.
| Compound Name | 9-[2-(2,2-dimethylpropylamino)ethyl]-2-fluoro-8-[[6-(furan-2-yl)-1H-indol-5-yl]methyl]purin-6-amine |
|---|---|
| PubChem CID | 67115876 |
| Molecular Formula | C25H28FN7O |
| Molecular Weight | 461.55 g/mol |
| Exact Mass | 461.23 |
| IUPAC Name | 9-[2-(2,2-dimethylpropylamino)ethyl]-2-fluoro-8-[[6-(furan-2-yl)-1H-indol-5-yl]methyl]purin-6-amine |
| SMILES | CC(C)(C)CNCCn1c(Cc2cc3cc[nH]c3cc2-c2ccco2)nc2c(N)nc(F)nc21 |
| InChI | InChI=1S/C25H28FN7O/c1-25(2,3)14-28-8-9-33-20(30-21-22(27)31-24(26)32-23(21)33)12-16-11-15-6-7-29-18(15)13-17(16)19-5-4-10-34-19/h4-7,10-11,13,28-29H,8-9,12,14H2,1-3H3,(H2,27,31,32) |
| InChIKey | UMYVCGUOGVLPMM-UHFFFAOYSA-N |
| XLogP | 4.52 |
| TPSA | 110.58 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.55 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|