C12H24Cl4O6Pt — CID 6711589
1,4,7,10,13,16-hexaoxacyclooctadecane;tetrachloroplatinum (PubChem CID 6711589) has the molecular formula C12H24Cl4O6Pt and a molecular weight of 601.21 g/mol. Its IUPAC name is 1,4,7,10,13,16-hexaoxacyclooctadecane;tetrachloroplatinum.
| Compound Name | 1,4,7,10,13,16-hexaoxacyclooctadecane;tetrachloroplatinum |
|---|---|
| PubChem CID | 6711589 |
| Molecular Formula | C12H24Cl4O6Pt |
| Molecular Weight | 601.21 g/mol |
| Exact Mass | 599.00 |
| IUPAC Name | 1,4,7,10,13,16-hexaoxacyclooctadecane;tetrachloroplatinum |
| SMILES | C1COCCOCCOCCOCCOCCO1.Cl[Pt](Cl)(Cl)Cl |
| InChI | InChI=1S/C12H24O6.4ClH.Pt/c1-2-14-5-6-16-9-10-18-12-11-17-8-7-15-4-3-13-1;;;;;/h1-12H2;4*1H;/q;;;;;+4/p-4 |
| InChIKey | JCVQYWVZDRRXIT-UHFFFAOYSA-J |
| XLogP | 2.86 |
| TPSA | 55.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 601.21 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |