C16H14F2O4 — CID 67116046
4-(4-ethyl-5-fluoro-2-methoxyphenoxy)-3-fluorobenzoic acid (PubChem CID 67116046) has the molecular formula C16H14F2O4 and a molecular weight of 308.28 g/mol. Its IUPAC name is 4-(4-ethyl-5-fluoro-2-methoxyphenoxy)-3-fluorobenzoic acid.
| Compound Name | 4-(4-ethyl-5-fluoro-2-methoxyphenoxy)-3-fluorobenzoic acid |
|---|---|
| PubChem CID | 67116046 |
| Molecular Formula | C16H14F2O4 |
| Molecular Weight | 308.28 g/mol |
| Exact Mass | 308.09 |
| IUPAC Name | 4-(4-ethyl-5-fluoro-2-methoxyphenoxy)-3-fluorobenzoic acid |
| SMILES | CCc1cc(OC)c(Oc2ccc(C(=O)O)cc2F)cc1F |
| InChI | InChI=1S/C16H14F2O4/c1-3-9-7-14(21-2)15(8-11(9)17)22-13-5-4-10(16(19)20)6-12(13)18/h4-8H,3H2,1-2H3,(H,19,20) |
| InChIKey | IBLDXHNDBHGWOS-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.28 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |