C24H23ClFN5O — CID 67116221
[2-(3-chloro-2-pyridinyl)-3-fluorophenyl]-[2-(4,6-dimethylpyrimidin-2-yl)-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-5-yl]methanone (PubChem CID 67116221) has the molecular formula C24H23ClFN5O and a molecular weight of 451.93 g/mol. Its IUPAC name is [2-(3-chloro-2-pyridinyl)-3-fluorophenyl]-[2-(4,6-dimethylpyrimidin-2-yl)-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-5-yl]methanone.
| Compound Name | [2-(3-chloro-2-pyridinyl)-3-fluorophenyl]-[2-(4,6-dimethylpyrimidin-2-yl)-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-5-yl]methanone |
|---|---|
| PubChem CID | 67116221 |
| Molecular Formula | C24H23ClFN5O |
| Molecular Weight | 451.93 g/mol |
| Exact Mass | 451.16 |
| IUPAC Name | [2-(3-chloro-2-pyridinyl)-3-fluorophenyl]-[2-(4,6-dimethylpyrimidin-2-yl)-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-5-yl]methanone |
| SMILES | Cc1cc(C)nc(N2CC3CN(C(=O)c4cccc(F)c4-c4ncccc4Cl)CC3C2)n1 |
| InChI | InChI=1S/C24H23ClFN5O/c1-14-9-15(2)29-24(28-14)31-12-16-10-30(11-17(16)13-31)23(32)18-5-3-7-20(26)21(18)22-19(25)6-4-8-27-22/h3-9,16-17H,10-13H2,1-2H3 |
| InChIKey | NXILJGRGFJUIEF-UHFFFAOYSA-N |
| XLogP | 4.16 |
| TPSA | 62.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.93 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |