C13H21N5O — CID 67116268
4-(2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrol-5-yl)-6-methoxy-N,N-dimethylpyrimidin-2-amine (PubChem CID 67116268) has the molecular formula C13H21N5O and a molecular weight of 263.34 g/mol. Its IUPAC name is 4-(2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrol-5-yl)-6-methoxy-N,N-dimethylpyrimidin-2-amine.
| Compound Name | 4-(2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrol-5-yl)-6-methoxy-N,N-dimethylpyrimidin-2-amine |
|---|---|
| PubChem CID | 67116268 |
| Molecular Formula | C13H21N5O |
| Molecular Weight | 263.34 g/mol |
| Exact Mass | 263.17 |
| IUPAC Name | 4-(2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrol-5-yl)-6-methoxy-N,N-dimethylpyrimidin-2-amine |
| SMILES | COc1cc(N2CC3CNCC3C2)nc(N(C)C)n1 |
| InChI | InChI=1S/C13H21N5O/c1-17(2)13-15-11(4-12(16-13)19-3)18-7-9-5-14-6-10(9)8-18/h4,9-10,14H,5-8H2,1-3H3 |
| InChIKey | JOBZZGLQFYQEFE-UHFFFAOYSA-N |
| XLogP | 0.21 |
| TPSA | 53.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.34 |
| LogP ≤ 5 | 0.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |