C24H21N3O2S — CID 67116330
[2-(1,3-benzoxazol-2-yl)-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-5-yl]-(2-thiophen-2-ylphenyl)methanone (PubChem CID 67116330) has the molecular formula C24H21N3O2S and a molecular weight of 415.52 g/mol. Its IUPAC name is [2-(1,3-benzoxazol-2-yl)-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-5-yl]-(2-thiophen-2-ylphenyl)methanone.
| Compound Name | [2-(1,3-benzoxazol-2-yl)-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-5-yl]-(2-thiophen-2-ylphenyl)methanone |
|---|---|
| PubChem CID | 67116330 |
| Molecular Formula | C24H21N3O2S |
| Molecular Weight | 415.52 g/mol |
| Exact Mass | 415.14 |
| IUPAC Name | [2-(1,3-benzoxazol-2-yl)-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-5-yl]-(2-thiophen-2-ylphenyl)methanone |
| SMILES | O=C(c1ccccc1-c1cccs1)N1CC2CN(c3nc4ccccc4o3)CC2C1 |
| InChI | InChI=1S/C24H21N3O2S/c28-23(19-7-2-1-6-18(19)22-10-5-11-30-22)26-12-16-14-27(15-17(16)13-26)24-25-20-8-3-4-9-21(20)29-24/h1-11,16-17H,12-15H2 |
| InChIKey | ZFRXDRJCCIBUSF-UHFFFAOYSA-N |
| XLogP | 4.76 |
| TPSA | 49.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.52 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |