C20H20FN7O — CID 67116347
[4-fluoro-2-(triazol-2-yl)phenyl]-[2-(6-methylpyrazin-2-yl)-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-5-yl]methanone (PubChem CID 67116347) has the molecular formula C20H20FN7O and a molecular weight of 393.43 g/mol. Its IUPAC name is [4-fluoro-2-(triazol-2-yl)phenyl]-[2-(6-methylpyrazin-2-yl)-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-5-yl]methanone.
| Compound Name | [4-fluoro-2-(triazol-2-yl)phenyl]-[2-(6-methylpyrazin-2-yl)-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-5-yl]methanone |
|---|---|
| PubChem CID | 67116347 |
| Molecular Formula | C20H20FN7O |
| Molecular Weight | 393.43 g/mol |
| Exact Mass | 393.17 |
| IUPAC Name | [4-fluoro-2-(triazol-2-yl)phenyl]-[2-(6-methylpyrazin-2-yl)-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-5-yl]methanone |
| SMILES | Cc1cncc(N2CC3CN(C(=O)c4ccc(F)cc4-n4nccn4)CC3C2)n1 |
| InChI | InChI=1S/C20H20FN7O/c1-13-7-22-8-19(25-13)26-9-14-11-27(12-15(14)10-26)20(29)17-3-2-16(21)6-18(17)28-23-4-5-24-28/h2-8,14-15H,9-12H2,1H3 |
| InChIKey | CJYNGMZSGMCHJD-UHFFFAOYSA-N |
| XLogP | 1.71 |
| TPSA | 80.04 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.43 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |