C21H24N8O — CID 67116381
[2-(4,6-dimethylpyrimidin-2-yl)-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-5-yl]-[6-methyl-2-(triazol-1-yl)-3-pyridinyl]methanone (PubChem CID 67116381) has the molecular formula C21H24N8O and a molecular weight of 404.48 g/mol. Its IUPAC name is [2-(4,6-dimethylpyrimidin-2-yl)-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-5-yl]-[6-methyl-2-(triazol-1-yl)-3-pyridinyl]methanone.
| Compound Name | [2-(4,6-dimethylpyrimidin-2-yl)-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-5-yl]-[6-methyl-2-(triazol-1-yl)-3-pyridinyl]methanone |
|---|---|
| PubChem CID | 67116381 |
| Molecular Formula | C21H24N8O |
| Molecular Weight | 404.48 g/mol |
| Exact Mass | 404.21 |
| IUPAC Name | [2-(4,6-dimethylpyrimidin-2-yl)-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-5-yl]-[6-methyl-2-(triazol-1-yl)-3-pyridinyl]methanone |
| SMILES | Cc1cc(C)nc(N2CC3CN(C(=O)c4ccc(C)nc4-n4ccnn4)CC3C2)n1 |
| InChI | InChI=1S/C21H24N8O/c1-13-4-5-18(19(23-13)29-7-6-22-26-29)20(30)27-9-16-11-28(12-17(16)10-27)21-24-14(2)8-15(3)25-21/h4-8,16-17H,9-12H2,1-3H3 |
| InChIKey | PRUSEJVDPONEIU-UHFFFAOYSA-N |
| XLogP | 1.59 |
| TPSA | 92.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.48 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |