C22H25N7O3S — CID 67116435
8-[[7-(1,3-oxazol-2-yl)-2,3-dihydro-1,4-benzodioxin-6-yl]sulfanyl]-9-[3-(propan-2-ylamino)propyl]purin-6-amine (PubChem CID 67116435) has the molecular formula C22H25N7O3S and a molecular weight of 467.56 g/mol. Its IUPAC name is 8-[[7-(1,3-oxazol-2-yl)-2,3-dihydro-1,4-benzodioxin-6-yl]sulfanyl]-9-[3-(propan-2-ylamino)propyl]purin-6-amine.
| Compound Name | 8-[[7-(1,3-oxazol-2-yl)-2,3-dihydro-1,4-benzodioxin-6-yl]sulfanyl]-9-[3-(propan-2-ylamino)propyl]purin-6-amine |
|---|---|
| PubChem CID | 67116435 |
| Molecular Formula | C22H25N7O3S |
| Molecular Weight | 467.56 g/mol |
| Exact Mass | 467.17 |
| IUPAC Name | 8-[[7-(1,3-oxazol-2-yl)-2,3-dihydro-1,4-benzodioxin-6-yl]sulfanyl]-9-[3-(propan-2-ylamino)propyl]purin-6-amine |
| SMILES | CC(C)NCCCn1c(Sc2cc3c(cc2-c2ncco2)OCCO3)nc2c(N)ncnc21 |
| InChI | InChI=1S/C22H25N7O3S/c1-13(2)24-4-3-6-29-20-18(19(23)26-12-27-20)28-22(29)33-17-11-16-15(30-8-9-31-16)10-14(17)21-25-5-7-32-21/h5,7,10-13,24H,3-4,6,8-9H2,1-2H3,(H2,23,26,27) |
| InChIKey | MUGGGVXWICQHOU-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 126.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.56 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|