About dichlorotitanium;bis(1H-inden-1-ide)
dichlorotitanium;bis(1H-inden-1-ide) (PubChem CID 6711659) has the molecular formula C18H14Cl2Ti-2
and a molecular weight of 349.08 g/mol. Its IUPAC name is dichlorotitanium;bis(1H-inden-1-ide).
Molecular Properties
| Compound Name | dichlorotitanium;bis(1H-inden-1-ide) |
| PubChem CID | 6711659 |
| Molecular Formula | C18H14Cl2Ti-2 |
| Molecular Weight | 349.08 g/mol |
| Exact Mass | 348.00 |
| IUPAC Name | dichlorotitanium;bis(1H-inden-1-ide) |
| SMILES | Cl[Ti]Cl.c1ccc2[cH-]ccc2c1.c1ccc2[cH-]ccc2c1 |
| InChI | InChI=1S/2C9H7.2ClH.Ti/c2*1-2-5-9-7-3-6-8(9)4-1;;;/h2*1-7H;2*1H;/q2*-1;;;+2/p-2 |
| InChIKey | YJRQGXLFYPFFMP-UHFFFAOYSA-L |
| XLogP | 6.49 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 349.08 |
| LogP ≤ 5 | 6.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|
Analyze dichlorotitanium;bis(1H-inden-1-ide) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of dichlorotitanium;bis(1H-inden-1-ide)?
The IUPAC name of dichlorotitanium;bis(1H-inden-1-ide) (CID 6711659) is dichlorotitanium;bis(1H-inden-1-ide).
What is the SMILES notation for dichlorotitanium;bis(1H-inden-1-ide)?
The canonical SMILES for dichlorotitanium;bis(1H-inden-1-ide) is Cl[Ti]Cl.c1ccc2[cH-]ccc2c1.c1ccc2[cH-]ccc2c1.
What is the InChIKey of dichlorotitanium;bis(1H-inden-1-ide)?
The InChIKey is YJRQGXLFYPFFMP-UHFFFAOYSA-L. The full InChI is InChI=1S/2C9H7.2ClH.Ti/c2*1-2-5-9-7-3-6-8(9)4-1;;;/h2*1-7H;2*1H;/q2*-1;;;+2/p-2.
What are the key properties of dichlorotitanium;bis(1H-inden-1-ide)?
dichlorotitanium;bis(1H-inden-1-ide) has a molecular weight of 349.08 g/mol, XLogP of 6.49, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for dichlorotitanium;bis(1H-inden-1-ide) is sourced from PubChem (CID 6711659), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).