C18H29N5O3 — CID 67116655
tert-butyl 2-[2-(dimethylamino)-6-methoxypyrimidin-4-yl]-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrole-5-carboxylate (PubChem CID 67116655) has the molecular formula C18H29N5O3 and a molecular weight of 363.46 g/mol. Its IUPAC name is tert-butyl 2-[2-(dimethylamino)-6-methoxypyrimidin-4-yl]-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrole-5-carboxylate.
| Compound Name | tert-butyl 2-[2-(dimethylamino)-6-methoxypyrimidin-4-yl]-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrole-5-carboxylate |
|---|---|
| PubChem CID | 67116655 |
| Molecular Formula | C18H29N5O3 |
| Molecular Weight | 363.46 g/mol |
| Exact Mass | 363.23 |
| IUPAC Name | tert-butyl 2-[2-(dimethylamino)-6-methoxypyrimidin-4-yl]-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrole-5-carboxylate |
| SMILES | COc1cc(N2CC3CN(C(=O)OC(C)(C)C)CC3C2)nc(N(C)C)n1 |
| InChI | InChI=1S/C18H29N5O3/c1-18(2,3)26-17(24)23-10-12-8-22(9-13(12)11-23)14-7-15(25-6)20-16(19-14)21(4)5/h7,12-13H,8-11H2,1-6H3 |
| InChIKey | NEIJIRFJXMVILY-UHFFFAOYSA-N |
| XLogP | 1.85 |
| TPSA | 71.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.46 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |