C23H27FN8O2 — CID 67117156
9-[3-(tert-butylamino)propyl]-2-fluoro-8-[[6-(1H-pyrazol-5-yl)-1,3-benzodioxol-5-yl]methyl]purin-6-amine (PubChem CID 67117156) has the molecular formula C23H27FN8O2 and a molecular weight of 466.52 g/mol. Its IUPAC name is 9-[3-(tert-butylamino)propyl]-2-fluoro-8-[[6-(1H-pyrazol-5-yl)-1,3-benzodioxol-5-yl]methyl]purin-6-amine.
| Compound Name | 9-[3-(tert-butylamino)propyl]-2-fluoro-8-[[6-(1H-pyrazol-5-yl)-1,3-benzodioxol-5-yl]methyl]purin-6-amine |
|---|---|
| PubChem CID | 67117156 |
| Molecular Formula | C23H27FN8O2 |
| Molecular Weight | 466.52 g/mol |
| Exact Mass | 466.22 |
| IUPAC Name | 9-[3-(tert-butylamino)propyl]-2-fluoro-8-[[6-(1H-pyrazol-5-yl)-1,3-benzodioxol-5-yl]methyl]purin-6-amine |
| SMILES | CC(C)(C)NCCCn1c(Cc2cc3c(cc2-c2ccn[nH]2)OCO3)nc2c(N)nc(F)nc21 |
| InChI | InChI=1S/C23H27FN8O2/c1-23(2,3)26-6-4-8-32-18(28-19-20(25)29-22(24)30-21(19)32)10-13-9-16-17(34-12-33-16)11-14(13)15-5-7-27-31-15/h5,7,9,11,26H,4,6,8,10,12H2,1-3H3,(H,27,31)(H2,25,29,30) |
| InChIKey | MCINGXDOYPFFSW-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 128.79 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.52 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|