C24H22FN7O2 — CID 67117168
[2-fluoro-6-(triazol-2-yl)phenyl]-[2-[4-(furan-2-yl)-6-methylpyrimidin-2-yl]-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-5-yl]methanone (PubChem CID 67117168) has the molecular formula C24H22FN7O2 and a molecular weight of 459.49 g/mol. Its IUPAC name is [2-fluoro-6-(triazol-2-yl)phenyl]-[2-[4-(furan-2-yl)-6-methylpyrimidin-2-yl]-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-5-yl]methanone.
| Compound Name | [2-fluoro-6-(triazol-2-yl)phenyl]-[2-[4-(furan-2-yl)-6-methylpyrimidin-2-yl]-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-5-yl]methanone |
|---|---|
| PubChem CID | 67117168 |
| Molecular Formula | C24H22FN7O2 |
| Molecular Weight | 459.49 g/mol |
| Exact Mass | 459.18 |
| IUPAC Name | [2-fluoro-6-(triazol-2-yl)phenyl]-[2-[4-(furan-2-yl)-6-methylpyrimidin-2-yl]-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-5-yl]methanone |
| SMILES | Cc1cc(-c2ccco2)nc(N2CC3CN(C(=O)c4c(F)cccc4-n4nccn4)CC3C2)n1 |
| InChI | InChI=1S/C24H22FN7O2/c1-15-10-19(21-6-3-9-34-21)29-24(28-15)31-13-16-11-30(12-17(16)14-31)23(33)22-18(25)4-2-5-20(22)32-26-7-8-27-32/h2-10,16-17H,11-14H2,1H3 |
| InChIKey | RLQRSDTYOLGDHZ-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 93.18 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.49 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |